About cis-(1S,2R)-2-(1,2,4-triazol-4-yl)cyclopentan-1-amine
cis-(1S,2R)-2-(1,2,4-triazol-4-yl)cyclopentan-1-amine (PubChem CID 178191125) has the molecular formula C7H12N4
and a molecular weight of 152.20 g/mol. Its IUPAC name is cis-(1S,2R)-2-(1,2,4-triazol-4-yl)cyclopentan-1-amine.
Analyze cis-(1S,2R)-2-(1,2,4-triazol-4-yl)cyclopentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1S,2R)-2-(1,2,4-triazol-4-yl)cyclopentan-1-amine?
The IUPAC name of cis-(1S,2R)-2-(1,2,4-triazol-4-yl)cyclopentan-1-amine (CID 178191125) is cis-(1S,2R)-2-(1,2,4-triazol-4-yl)cyclopentan-1-amine.
What is the SMILES notation for cis-(1S,2R)-2-(1,2,4-triazol-4-yl)cyclopentan-1-amine?
The canonical SMILES for cis-(1S,2R)-2-(1,2,4-triazol-4-yl)cyclopentan-1-amine is N[C@H]1CCC[C@H]1n1cnnc1.
What is the InChIKey of cis-(1S,2R)-2-(1,2,4-triazol-4-yl)cyclopentan-1-amine?
The InChIKey is DITMBZFQBXFPMH-NKWVEPMBSA-N. The full InChI is InChI=1S/C7H12N4/c8-6-2-1-3-7(6)11-4-9-10-5-11/h4-7H,1-3,8H2/t6-,7+/m0/s1.
What are the key properties of cis-(1S,2R)-2-(1,2,4-triazol-4-yl)cyclopentan-1-amine?
cis-(1S,2R)-2-(1,2,4-triazol-4-yl)cyclopentan-1-amine has a molecular weight of 152.20 g/mol, XLogP of 0.33, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1S,2R)-2-(1,2,4-triazol-4-yl)cyclopentan-1-amine is sourced from PubChem (CID 178191125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).