C7H14N2 — CID 178194389
(1R,5R,6S)-bicyclo[3.2.0]heptane-3,6-diamine (PubChem CID 178194389) has the molecular formula C7H14N2 and a molecular weight of 126.20 g/mol. Its IUPAC name is (1R,5R,6S)-bicyclo[3.2.0]heptane-3,6-diamine.
| Compound Name | (1R,5R,6S)-bicyclo[3.2.0]heptane-3,6-diamine |
|---|---|
| PubChem CID | 178194389 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | (1R,5R,6S)-bicyclo[3.2.0]heptane-3,6-diamine |
| SMILES | NC1C[C@@H]2C[C@H](N)[C@@H]2C1 |
| InChI | InChI=1S/C7H14N2/c8-5-1-4-2-7(9)6(4)3-5/h4-7H,1-3,8-9H2/t4-,5?,6-,7+/m1/s1 |
| InChIKey | DQLYPIDQNLQOKL-ZUMNNYEFSA-N |
| XLogP | 0.07 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |