C14H22N2O — CID 178196562
(2S,3R)-2-(3-methoxyphenyl)-1-propan-2-ylpyrrolidin-3-amine (PubChem CID 178196562) has the molecular formula C14H22N2O and a molecular weight of 234.34 g/mol. Its IUPAC name is (2S,3R)-2-(3-methoxyphenyl)-1-propan-2-ylpyrrolidin-3-amine.
| Compound Name | (2S,3R)-2-(3-methoxyphenyl)-1-propan-2-ylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 178196562 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | (2S,3R)-2-(3-methoxyphenyl)-1-propan-2-ylpyrrolidin-3-amine |
| SMILES | COc1cccc([C@H]2[C@H](N)CCN2C(C)C)c1 |
| InChI | InChI=1S/C14H22N2O/c1-10(2)16-8-7-13(15)14(16)11-5-4-6-12(9-11)17-3/h4-6,9-10,13-14H,7-8,15H2,1-3H3/t13-,14+/m1/s1 |
| InChIKey | PLTQDFBDLGONDS-KGLIPLIRSA-N |
| XLogP | 2.18 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |