About (4R,5S)-4-amino-5-(1,5-dimethylpyrazol-4-yl)-1-propan-2-ylpyrrolidin-2-one
(4R,5S)-4-amino-5-(1,5-dimethylpyrazol-4-yl)-1-propan-2-ylpyrrolidin-2-one (PubChem CID 178196676) has the molecular formula C12H20N4O
and a molecular weight of 236.32 g/mol. Its IUPAC name is (4R,5S)-4-amino-5-(1,5-dimethylpyrazol-4-yl)-1-propan-2-ylpyrrolidin-2-one.
Molecular Properties
| Compound Name | (4R,5S)-4-amino-5-(1,5-dimethylpyrazol-4-yl)-1-propan-2-ylpyrrolidin-2-one |
| PubChem CID | 178196676 |
| Molecular Formula | C12H20N4O |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | (4R,5S)-4-amino-5-(1,5-dimethylpyrazol-4-yl)-1-propan-2-ylpyrrolidin-2-one |
| SMILES | Cc1c([C@H]2[C@H](N)CC(=O)N2C(C)C)cnn1C |
| InChI | InChI=1S/C12H20N4O/c1-7(2)16-11(17)5-10(13)12(16)9-6-14-15(4)8(9)3/h6-7,10,12H,5,13H2,1-4H3/t10-,12+/m1/s1 |
| InChIKey | KFUYVBYIRPTCSG-PWSUYJOCSA-N |
| XLogP | 0.74 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4R,5S)-4-amino-5-(1,5-dimethylpyrazol-4-yl)-1-propan-2-ylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R,5S)-4-amino-5-(1,5-dimethylpyrazol-4-yl)-1-propan-2-ylpyrrolidin-2-one?
The IUPAC name of (4R,5S)-4-amino-5-(1,5-dimethylpyrazol-4-yl)-1-propan-2-ylpyrrolidin-2-one (CID 178196676) is (4R,5S)-4-amino-5-(1,5-dimethylpyrazol-4-yl)-1-propan-2-ylpyrrolidin-2-one.
What is the SMILES notation for (4R,5S)-4-amino-5-(1,5-dimethylpyrazol-4-yl)-1-propan-2-ylpyrrolidin-2-one?
The canonical SMILES for (4R,5S)-4-amino-5-(1,5-dimethylpyrazol-4-yl)-1-propan-2-ylpyrrolidin-2-one is Cc1c([C@H]2[C@H](N)CC(=O)N2C(C)C)cnn1C.
What is the InChIKey of (4R,5S)-4-amino-5-(1,5-dimethylpyrazol-4-yl)-1-propan-2-ylpyrrolidin-2-one?
The InChIKey is KFUYVBYIRPTCSG-PWSUYJOCSA-N. The full InChI is InChI=1S/C12H20N4O/c1-7(2)16-11(17)5-10(13)12(16)9-6-14-15(4)8(9)3/h6-7,10,12H,5,13H2,1-4H3/t10-,12+/m1/s1.
What are the key properties of (4R,5S)-4-amino-5-(1,5-dimethylpyrazol-4-yl)-1-propan-2-ylpyrrolidin-2-one?
(4R,5S)-4-amino-5-(1,5-dimethylpyrazol-4-yl)-1-propan-2-ylpyrrolidin-2-one has a molecular weight of 236.32 g/mol, XLogP of 0.74, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4R,5S)-4-amino-5-(1,5-dimethylpyrazol-4-yl)-1-propan-2-ylpyrrolidin-2-one is sourced from PubChem (CID 178196676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).