About (2S,3S)-2-(2-propan-2-yl-1,3-thiazol-4-yl)-1-propylpyrrolidin-3-amine
(2S,3S)-2-(2-propan-2-yl-1,3-thiazol-4-yl)-1-propylpyrrolidin-3-amine (PubChem CID 178196692) has the molecular formula C13H23N3S
and a molecular weight of 253.41 g/mol. Its IUPAC name is (2S,3S)-2-(2-propan-2-yl-1,3-thiazol-4-yl)-1-propylpyrrolidin-3-amine.
Molecular Properties
| Compound Name | (2S,3S)-2-(2-propan-2-yl-1,3-thiazol-4-yl)-1-propylpyrrolidin-3-amine |
| PubChem CID | 178196692 |
| Molecular Formula | C13H23N3S |
| Molecular Weight | 253.41 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | (2S,3S)-2-(2-propan-2-yl-1,3-thiazol-4-yl)-1-propylpyrrolidin-3-amine |
| SMILES | CCCN1CC[C@H](N)[C@H]1c1csc(C(C)C)n1 |
| InChI | InChI=1S/C13H23N3S/c1-4-6-16-7-5-10(14)12(16)11-8-17-13(15-11)9(2)3/h8-10,12H,4-7,14H2,1-3H3/t10-,12-/m0/s1 |
| InChIKey | YHYXZGAVLLOFCO-JQWIXIFHSA-N |
| XLogP | 2.75 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.41 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S,3S)-2-(2-propan-2-yl-1,3-thiazol-4-yl)-1-propylpyrrolidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3S)-2-(2-propan-2-yl-1,3-thiazol-4-yl)-1-propylpyrrolidin-3-amine?
The IUPAC name of (2S,3S)-2-(2-propan-2-yl-1,3-thiazol-4-yl)-1-propylpyrrolidin-3-amine (CID 178196692) is (2S,3S)-2-(2-propan-2-yl-1,3-thiazol-4-yl)-1-propylpyrrolidin-3-amine.
What is the SMILES notation for (2S,3S)-2-(2-propan-2-yl-1,3-thiazol-4-yl)-1-propylpyrrolidin-3-amine?
The canonical SMILES for (2S,3S)-2-(2-propan-2-yl-1,3-thiazol-4-yl)-1-propylpyrrolidin-3-amine is CCCN1CC[C@H](N)[C@H]1c1csc(C(C)C)n1.
What is the InChIKey of (2S,3S)-2-(2-propan-2-yl-1,3-thiazol-4-yl)-1-propylpyrrolidin-3-amine?
The InChIKey is YHYXZGAVLLOFCO-JQWIXIFHSA-N. The full InChI is InChI=1S/C13H23N3S/c1-4-6-16-7-5-10(14)12(16)11-8-17-13(15-11)9(2)3/h8-10,12H,4-7,14H2,1-3H3/t10-,12-/m0/s1.
What are the key properties of (2S,3S)-2-(2-propan-2-yl-1,3-thiazol-4-yl)-1-propylpyrrolidin-3-amine?
(2S,3S)-2-(2-propan-2-yl-1,3-thiazol-4-yl)-1-propylpyrrolidin-3-amine has a molecular weight of 253.41 g/mol, XLogP of 2.75, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3S)-2-(2-propan-2-yl-1,3-thiazol-4-yl)-1-propylpyrrolidin-3-amine is sourced from PubChem (CID 178196692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).