About [(1S,3S)-2,2-dimethyl-3-(4-methylsulfanylphenyl)cyclopropyl]methanamine
[(1S,3S)-2,2-dimethyl-3-(4-methylsulfanylphenyl)cyclopropyl]methanamine (PubChem CID 178197130) has the molecular formula C13H19NS
and a molecular weight of 221.37 g/mol. Its IUPAC name is [(1S,3S)-2,2-dimethyl-3-(4-methylsulfanylphenyl)cyclopropyl]methanamine.
Molecular Properties
| Compound Name | [(1S,3S)-2,2-dimethyl-3-(4-methylsulfanylphenyl)cyclopropyl]methanamine |
| PubChem CID | 178197130 |
| Molecular Formula | C13H19NS |
| Molecular Weight | 221.37 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | [(1S,3S)-2,2-dimethyl-3-(4-methylsulfanylphenyl)cyclopropyl]methanamine |
| SMILES | CSc1ccc([C@H]2[C@H](CN)C2(C)C)cc1 |
| InChI | InChI=1S/C13H19NS/c1-13(2)11(8-14)12(13)9-4-6-10(15-3)7-5-9/h4-7,11-12H,8,14H2,1-3H3/t11-,12-/m0/s1 |
| InChIKey | WYDGPXJYCMLCON-RYUDHWBXSA-N |
| XLogP | 3.11 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.37 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(1S,3S)-2,2-dimethyl-3-(4-methylsulfanylphenyl)cyclopropyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,3S)-2,2-dimethyl-3-(4-methylsulfanylphenyl)cyclopropyl]methanamine?
The IUPAC name of [(1S,3S)-2,2-dimethyl-3-(4-methylsulfanylphenyl)cyclopropyl]methanamine (CID 178197130) is [(1S,3S)-2,2-dimethyl-3-(4-methylsulfanylphenyl)cyclopropyl]methanamine.
What is the SMILES notation for [(1S,3S)-2,2-dimethyl-3-(4-methylsulfanylphenyl)cyclopropyl]methanamine?
The canonical SMILES for [(1S,3S)-2,2-dimethyl-3-(4-methylsulfanylphenyl)cyclopropyl]methanamine is CSc1ccc([C@H]2[C@H](CN)C2(C)C)cc1.
What is the InChIKey of [(1S,3S)-2,2-dimethyl-3-(4-methylsulfanylphenyl)cyclopropyl]methanamine?
The InChIKey is WYDGPXJYCMLCON-RYUDHWBXSA-N. The full InChI is InChI=1S/C13H19NS/c1-13(2)11(8-14)12(13)9-4-6-10(15-3)7-5-9/h4-7,11-12H,8,14H2,1-3H3/t11-,12-/m0/s1.
What are the key properties of [(1S,3S)-2,2-dimethyl-3-(4-methylsulfanylphenyl)cyclopropyl]methanamine?
[(1S,3S)-2,2-dimethyl-3-(4-methylsulfanylphenyl)cyclopropyl]methanamine has a molecular weight of 221.37 g/mol, XLogP of 3.11, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,3S)-2,2-dimethyl-3-(4-methylsulfanylphenyl)cyclopropyl]methanamine is sourced from PubChem (CID 178197130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).