C11H14FNO — CID 178197444
4-[(1R,3R)-3-amino-2,2-dimethylcyclopropyl]-3-fluorophenol (PubChem CID 178197444) has the molecular formula C11H14FNO and a molecular weight of 195.24 g/mol. Its IUPAC name is 4-[(1R,3R)-3-amino-2,2-dimethylcyclopropyl]-3-fluorophenol.
| Compound Name | 4-[(1R,3R)-3-amino-2,2-dimethylcyclopropyl]-3-fluorophenol |
|---|---|
| PubChem CID | 178197444 |
| Molecular Formula | C11H14FNO |
| Molecular Weight | 195.24 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | 4-[(1R,3R)-3-amino-2,2-dimethylcyclopropyl]-3-fluorophenol |
| SMILES | CC1(C)[C@H](N)[C@H]1c1ccc(O)cc1F |
| InChI | InChI=1S/C11H14FNO/c1-11(2)9(10(11)13)7-4-3-6(14)5-8(7)12/h3-5,9-10,14H,13H2,1-2H3/t9-,10-/m1/s1 |
| InChIKey | STHBQMPTYFCREZ-NXEZZACHSA-N |
| XLogP | 1.98 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.24 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |