About [(1S,3S)-2,2-dimethyl-3-(2-methylpyrazol-3-yl)cyclopropyl]methanamine
[(1S,3S)-2,2-dimethyl-3-(2-methylpyrazol-3-yl)cyclopropyl]methanamine (PubChem CID 178197771) has the molecular formula C10H17N3
and a molecular weight of 179.27 g/mol. Its IUPAC name is [(1S,3S)-2,2-dimethyl-3-(2-methylpyrazol-3-yl)cyclopropyl]methanamine.
Molecular Properties
| Compound Name | [(1S,3S)-2,2-dimethyl-3-(2-methylpyrazol-3-yl)cyclopropyl]methanamine |
| PubChem CID | 178197771 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | [(1S,3S)-2,2-dimethyl-3-(2-methylpyrazol-3-yl)cyclopropyl]methanamine |
| SMILES | Cn1nccc1[C@H]1[C@H](CN)C1(C)C |
| InChI | InChI=1S/C10H17N3/c1-10(2)7(6-11)9(10)8-4-5-12-13(8)3/h4-5,7,9H,6,11H2,1-3H3/t7-,9+/m0/s1 |
| InChIKey | JILSTXCHSUYFAJ-IONNQARKSA-N |
| XLogP | 1.12 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(1S,3S)-2,2-dimethyl-3-(2-methylpyrazol-3-yl)cyclopropyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,3S)-2,2-dimethyl-3-(2-methylpyrazol-3-yl)cyclopropyl]methanamine?
The IUPAC name of [(1S,3S)-2,2-dimethyl-3-(2-methylpyrazol-3-yl)cyclopropyl]methanamine (CID 178197771) is [(1S,3S)-2,2-dimethyl-3-(2-methylpyrazol-3-yl)cyclopropyl]methanamine.
What is the SMILES notation for [(1S,3S)-2,2-dimethyl-3-(2-methylpyrazol-3-yl)cyclopropyl]methanamine?
The canonical SMILES for [(1S,3S)-2,2-dimethyl-3-(2-methylpyrazol-3-yl)cyclopropyl]methanamine is Cn1nccc1[C@H]1[C@H](CN)C1(C)C.
What is the InChIKey of [(1S,3S)-2,2-dimethyl-3-(2-methylpyrazol-3-yl)cyclopropyl]methanamine?
The InChIKey is JILSTXCHSUYFAJ-IONNQARKSA-N. The full InChI is InChI=1S/C10H17N3/c1-10(2)7(6-11)9(10)8-4-5-12-13(8)3/h4-5,7,9H,6,11H2,1-3H3/t7-,9+/m0/s1.
What are the key properties of [(1S,3S)-2,2-dimethyl-3-(2-methylpyrazol-3-yl)cyclopropyl]methanamine?
[(1S,3S)-2,2-dimethyl-3-(2-methylpyrazol-3-yl)cyclopropyl]methanamine has a molecular weight of 179.27 g/mol, XLogP of 1.12, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,3S)-2,2-dimethyl-3-(2-methylpyrazol-3-yl)cyclopropyl]methanamine is sourced from PubChem (CID 178197771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).