C13H25NO — CID 178199486
(4aR,8aS)-7-(2-methylbutan-2-yl)-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[b][1,4]oxazine (PubChem CID 178199486) has the molecular formula C13H25NO and a molecular weight of 211.35 g/mol. Its IUPAC name is (4aR,8aS)-7-(2-methylbutan-2-yl)-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[b][1,4]oxazine.
| Compound Name | (4aR,8aS)-7-(2-methylbutan-2-yl)-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[b][1,4]oxazine |
|---|---|
| PubChem CID | 178199486 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | (4aR,8aS)-7-(2-methylbutan-2-yl)-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[b][1,4]oxazine |
| SMILES | CCC(C)(C)C1CC[C@H]2NCCO[C@H]2C1 |
| InChI | InChI=1S/C13H25NO/c1-4-13(2,3)10-5-6-11-12(9-10)15-8-7-14-11/h10-12,14H,4-9H2,1-3H3/t10?,11-,12+/m1/s1 |
| InChIKey | GRPMINPYADYJER-SAIIYOCFSA-N |
| XLogP | 2.58 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |