C12H23N3O — CID 178199557
(3aR,7aR)-N-butyl-1,2,3,3a,4,5,7,7a-octahydropyrrolo[2,3-c]pyridine-6-carboxamide (PubChem CID 178199557) has the molecular formula C12H23N3O and a molecular weight of 225.34 g/mol. Its IUPAC name is (3aR,7aR)-N-butyl-1,2,3,3a,4,5,7,7a-octahydropyrrolo[2,3-c]pyridine-6-carboxamide.
| Compound Name | (3aR,7aR)-N-butyl-1,2,3,3a,4,5,7,7a-octahydropyrrolo[2,3-c]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 178199557 |
| Molecular Formula | C12H23N3O |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.18 |
| IUPAC Name | (3aR,7aR)-N-butyl-1,2,3,3a,4,5,7,7a-octahydropyrrolo[2,3-c]pyridine-6-carboxamide |
| SMILES | CCCCNC(=O)N1CC[C@H]2CCN[C@H]2C1 |
| InChI | InChI=1S/C12H23N3O/c1-2-3-6-14-12(16)15-8-5-10-4-7-13-11(10)9-15/h10-11,13H,2-9H2,1H3,(H,14,16)/t10-,11+/m1/s1 |
| InChIKey | VFFGHCUSYDNIMO-MNOVXSKESA-N |
| XLogP | 1.18 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|