C13H21N3 — CID 178199859
(2R,3S)-2-(3-aminophenyl)-1-propylpyrrolidin-3-amine (PubChem CID 178199859) has the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. Its IUPAC name is (2R,3S)-2-(3-aminophenyl)-1-propylpyrrolidin-3-amine.
| Compound Name | (2R,3S)-2-(3-aminophenyl)-1-propylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 178199859 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | (2R,3S)-2-(3-aminophenyl)-1-propylpyrrolidin-3-amine |
| SMILES | CCCN1CC[C@H](N)[C@H]1c1cccc(N)c1 |
| InChI | InChI=1S/C13H21N3/c1-2-7-16-8-6-12(15)13(16)10-4-3-5-11(14)9-10/h3-5,9,12-13H,2,6-8,14-15H2,1H3/t12-,13+/m0/s1 |
| InChIKey | NYGPHRJWAWWNAU-QWHCGFSZSA-N |
| XLogP | 1.75 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|