C6H11NO2 — CID 178199894
1-[(2S,3R)-3-aminooxolan-2-yl]ethanone (PubChem CID 178199894) has the molecular formula C6H11NO2 and a molecular weight of 129.16 g/mol. Its IUPAC name is 1-[(2S,3R)-3-aminooxolan-2-yl]ethanone.
| Compound Name | 1-[(2S,3R)-3-aminooxolan-2-yl]ethanone |
|---|---|
| PubChem CID | 178199894 |
| Molecular Formula | C6H11NO2 |
| Molecular Weight | 129.16 g/mol |
| Exact Mass | 129.08 |
| IUPAC Name | 1-[(2S,3R)-3-aminooxolan-2-yl]ethanone |
| SMILES | CC(=O)[C@H]1OCC[C@H]1N |
| InChI | InChI=1S/C6H11NO2/c1-4(8)6-5(7)2-3-9-6/h5-6H,2-3,7H2,1H3/t5-,6-/m1/s1 |
| InChIKey | IXLXLBQMKNNINI-PHDIDXHHSA-N |
| XLogP | -0.31 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.16 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |