About sodium trans-(1S,2S)-2-(hydroxymethyl)-1-methylcyclopropane-1-carboxylate
sodium trans-(1S,2S)-2-(hydroxymethyl)-1-methylcyclopropane-1-carboxylate (PubChem CID 178200007) has the molecular formula C6H9NaO3
and a molecular weight of 152.12 g/mol. Its IUPAC name is sodium trans-(1S,2S)-2-(hydroxymethyl)-1-methylcyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | sodium trans-(1S,2S)-2-(hydroxymethyl)-1-methylcyclopropane-1-carboxylate |
| PubChem CID | 178200007 |
| Molecular Formula | C6H9NaO3 |
| Molecular Weight | 152.12 g/mol |
| Exact Mass | 152.04 |
| IUPAC Name | sodium trans-(1S,2S)-2-(hydroxymethyl)-1-methylcyclopropane-1-carboxylate |
| SMILES | C[C@]1(C(=O)[O-])C[C@@H]1CO.[Na+] |
| InChI | InChI=1S/C6H10O3.Na/c1-6(5(8)9)2-4(6)3-7;/h4,7H,2-3H2,1H3,(H,8,9);/q;+1/p-1/t4-,6+;/m1./s1 |
| InChIKey | KRIOJAOIESNGOR-MYSBMPOLSA-M |
| XLogP | -4.24 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.12 |
| LogP ≤ 5 | -4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze sodium trans-(1S,2S)-2-(hydroxymethyl)-1-methylcyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium trans-(1S,2S)-2-(hydroxymethyl)-1-methylcyclopropane-1-carboxylate?
The IUPAC name of sodium trans-(1S,2S)-2-(hydroxymethyl)-1-methylcyclopropane-1-carboxylate (CID 178200007) is sodium trans-(1S,2S)-2-(hydroxymethyl)-1-methylcyclopropane-1-carboxylate.
What is the SMILES notation for sodium trans-(1S,2S)-2-(hydroxymethyl)-1-methylcyclopropane-1-carboxylate?
The canonical SMILES for sodium trans-(1S,2S)-2-(hydroxymethyl)-1-methylcyclopropane-1-carboxylate is C[C@]1(C(=O)[O-])C[C@@H]1CO.[Na+].
What is the InChIKey of sodium trans-(1S,2S)-2-(hydroxymethyl)-1-methylcyclopropane-1-carboxylate?
The InChIKey is KRIOJAOIESNGOR-MYSBMPOLSA-M. The full InChI is InChI=1S/C6H10O3.Na/c1-6(5(8)9)2-4(6)3-7;/h4,7H,2-3H2,1H3,(H,8,9);/q;+1/p-1/t4-,6+;/m1./s1.
What are the key properties of sodium trans-(1S,2S)-2-(hydroxymethyl)-1-methylcyclopropane-1-carboxylate?
sodium trans-(1S,2S)-2-(hydroxymethyl)-1-methylcyclopropane-1-carboxylate has a molecular weight of 152.12 g/mol, XLogP of -4.24, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium trans-(1S,2S)-2-(hydroxymethyl)-1-methylcyclopropane-1-carboxylate is sourced from PubChem (CID 178200007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).