About [2-(aminomethyl)-1,3-thiazol-5-yl]methanol;dihydrochloride
[2-(aminomethyl)-1,3-thiazol-5-yl]methanol;dihydrochloride (PubChem CID 178200033) has the molecular formula C5H10Cl2N2OS
and a molecular weight of 217.12 g/mol. Its IUPAC name is [2-(aminomethyl)-1,3-thiazol-5-yl]methanol;dihydrochloride.
Molecular Properties
| Compound Name | [2-(aminomethyl)-1,3-thiazol-5-yl]methanol;dihydrochloride |
| PubChem CID | 178200033 |
| Molecular Formula | C5H10Cl2N2OS |
| Molecular Weight | 217.12 g/mol |
| Exact Mass | 215.99 |
| IUPAC Name | [2-(aminomethyl)-1,3-thiazol-5-yl]methanol;dihydrochloride |
| SMILES | Cl.Cl.NCc1ncc(CO)s1 |
| InChI | InChI=1S/C5H8N2OS.2ClH/c6-1-5-7-2-4(3-8)9-5;;/h2,8H,1,3,6H2;2*1H |
| InChIKey | LGULVSLZKCSLRW-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.12 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(aminomethyl)-1,3-thiazol-5-yl]methanol;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(aminomethyl)-1,3-thiazol-5-yl]methanol;dihydrochloride?
The IUPAC name of [2-(aminomethyl)-1,3-thiazol-5-yl]methanol;dihydrochloride (CID 178200033) is [2-(aminomethyl)-1,3-thiazol-5-yl]methanol;dihydrochloride.
What is the SMILES notation for [2-(aminomethyl)-1,3-thiazol-5-yl]methanol;dihydrochloride?
The canonical SMILES for [2-(aminomethyl)-1,3-thiazol-5-yl]methanol;dihydrochloride is Cl.Cl.NCc1ncc(CO)s1.
What is the InChIKey of [2-(aminomethyl)-1,3-thiazol-5-yl]methanol;dihydrochloride?
The InChIKey is LGULVSLZKCSLRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2OS.2ClH/c6-1-5-7-2-4(3-8)9-5;;/h2,8H,1,3,6H2;2*1H.
What are the key properties of [2-(aminomethyl)-1,3-thiazol-5-yl]methanol;dihydrochloride?
[2-(aminomethyl)-1,3-thiazol-5-yl]methanol;dihydrochloride has a molecular weight of 217.12 g/mol, XLogP of 0.94, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(aminomethyl)-1,3-thiazol-5-yl]methanol;dihydrochloride is sourced from PubChem (CID 178200033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).