About 3-(2-aminopropan-2-yl)-4H-1,2,4-oxadiazol-5-one;hydrochloride
3-(2-aminopropan-2-yl)-4H-1,2,4-oxadiazol-5-one;hydrochloride (PubChem CID 178200108) has the molecular formula C5H10ClN3O2
and a molecular weight of 179.61 g/mol. Its IUPAC name is 3-(2-aminopropan-2-yl)-4H-1,2,4-oxadiazol-5-one;hydrochloride.
Molecular Properties
| Compound Name | 3-(2-aminopropan-2-yl)-4H-1,2,4-oxadiazol-5-one;hydrochloride |
| PubChem CID | 178200108 |
| Molecular Formula | C5H10ClN3O2 |
| Molecular Weight | 179.61 g/mol |
| Exact Mass | 179.05 |
| IUPAC Name | 3-(2-aminopropan-2-yl)-4H-1,2,4-oxadiazol-5-one;hydrochloride |
| SMILES | CC(C)(N)c1noc(=O)[nH]1.Cl |
| InChI | InChI=1S/C5H9N3O2.ClH/c1-5(2,6)3-7-4(9)10-8-3;/h6H2,1-2H3,(H,7,8,9);1H |
| InChIKey | GFFNRUZIICOVQO-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.61 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(2-aminopropan-2-yl)-4H-1,2,4-oxadiazol-5-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-aminopropan-2-yl)-4H-1,2,4-oxadiazol-5-one;hydrochloride?
The IUPAC name of 3-(2-aminopropan-2-yl)-4H-1,2,4-oxadiazol-5-one;hydrochloride (CID 178200108) is 3-(2-aminopropan-2-yl)-4H-1,2,4-oxadiazol-5-one;hydrochloride.
What is the SMILES notation for 3-(2-aminopropan-2-yl)-4H-1,2,4-oxadiazol-5-one;hydrochloride?
The canonical SMILES for 3-(2-aminopropan-2-yl)-4H-1,2,4-oxadiazol-5-one;hydrochloride is CC(C)(N)c1noc(=O)[nH]1.Cl.
What is the InChIKey of 3-(2-aminopropan-2-yl)-4H-1,2,4-oxadiazol-5-one;hydrochloride?
The InChIKey is GFFNRUZIICOVQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N3O2.ClH/c1-5(2,6)3-7-4(9)10-8-3;/h6H2,1-2H3,(H,7,8,9);1H.
What are the key properties of 3-(2-aminopropan-2-yl)-4H-1,2,4-oxadiazol-5-one;hydrochloride?
3-(2-aminopropan-2-yl)-4H-1,2,4-oxadiazol-5-one;hydrochloride has a molecular weight of 179.61 g/mol, XLogP of -0.02, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-aminopropan-2-yl)-4H-1,2,4-oxadiazol-5-one;hydrochloride is sourced from PubChem (CID 178200108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).