About 3-amino-5H-[1,2]oxazolo[5,4-d]pyrimidin-4-one
3-amino-5H-[1,2]oxazolo[5,4-d]pyrimidin-4-one (PubChem CID 178200218) has the molecular formula C5H4N4O2
and a molecular weight of 152.11 g/mol. Its IUPAC name is 3-amino-5H-[1,2]oxazolo[5,4-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 3-amino-5H-[1,2]oxazolo[5,4-d]pyrimidin-4-one |
| PubChem CID | 178200218 |
| Molecular Formula | C5H4N4O2 |
| Molecular Weight | 152.11 g/mol |
| Exact Mass | 152.03 |
| IUPAC Name | 3-amino-5H-[1,2]oxazolo[5,4-d]pyrimidin-4-one |
| SMILES | Nc1noc2nc[nH]c(=O)c12 |
| InChI | InChI=1S/C5H4N4O2/c6-3-2-4(10)7-1-8-5(2)11-9-3/h1H,(H2,6,9)(H,7,8,10) |
| InChIKey | DNVMKHFOMSKJQO-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 97.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.11 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-amino-5H-[1,2]oxazolo[5,4-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-5H-[1,2]oxazolo[5,4-d]pyrimidin-4-one?
The IUPAC name of 3-amino-5H-[1,2]oxazolo[5,4-d]pyrimidin-4-one (CID 178200218) is 3-amino-5H-[1,2]oxazolo[5,4-d]pyrimidin-4-one.
What is the SMILES notation for 3-amino-5H-[1,2]oxazolo[5,4-d]pyrimidin-4-one?
The canonical SMILES for 3-amino-5H-[1,2]oxazolo[5,4-d]pyrimidin-4-one is Nc1noc2nc[nH]c(=O)c12.
What is the InChIKey of 3-amino-5H-[1,2]oxazolo[5,4-d]pyrimidin-4-one?
The InChIKey is DNVMKHFOMSKJQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N4O2/c6-3-2-4(10)7-1-8-5(2)11-9-3/h1H,(H2,6,9)(H,7,8,10).
What are the key properties of 3-amino-5H-[1,2]oxazolo[5,4-d]pyrimidin-4-one?
3-amino-5H-[1,2]oxazolo[5,4-d]pyrimidin-4-one has a molecular weight of 152.11 g/mol, XLogP of -0.51, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-5H-[1,2]oxazolo[5,4-d]pyrimidin-4-one is sourced from PubChem (CID 178200218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).