About ethyl 3-(hydroxymethyl)-1,2-oxazole-5-carboxylate
ethyl 3-(hydroxymethyl)-1,2-oxazole-5-carboxylate (PubChem CID 178200808) has the molecular formula C7H9NO4
and a molecular weight of 171.15 g/mol. Its IUPAC name is ethyl 3-(hydroxymethyl)-1,2-oxazole-5-carboxylate.
Molecular Properties
| Compound Name | ethyl 3-(hydroxymethyl)-1,2-oxazole-5-carboxylate |
| PubChem CID | 178200808 |
| Molecular Formula | C7H9NO4 |
| Molecular Weight | 171.15 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | ethyl 3-(hydroxymethyl)-1,2-oxazole-5-carboxylate |
| SMILES | CCOC(=O)c1cc(CO)no1 |
| InChI | InChI=1S/C7H9NO4/c1-2-11-7(10)6-3-5(4-9)8-12-6/h3,9H,2,4H2,1H3 |
| InChIKey | XRAPPFSIIXGSNO-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.15 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 3-(hydroxymethyl)-1,2-oxazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-(hydroxymethyl)-1,2-oxazole-5-carboxylate?
The IUPAC name of ethyl 3-(hydroxymethyl)-1,2-oxazole-5-carboxylate (CID 178200808) is ethyl 3-(hydroxymethyl)-1,2-oxazole-5-carboxylate.
What is the SMILES notation for ethyl 3-(hydroxymethyl)-1,2-oxazole-5-carboxylate?
The canonical SMILES for ethyl 3-(hydroxymethyl)-1,2-oxazole-5-carboxylate is CCOC(=O)c1cc(CO)no1.
What is the InChIKey of ethyl 3-(hydroxymethyl)-1,2-oxazole-5-carboxylate?
The InChIKey is XRAPPFSIIXGSNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO4/c1-2-11-7(10)6-3-5(4-9)8-12-6/h3,9H,2,4H2,1H3.
What are the key properties of ethyl 3-(hydroxymethyl)-1,2-oxazole-5-carboxylate?
ethyl 3-(hydroxymethyl)-1,2-oxazole-5-carboxylate has a molecular weight of 171.15 g/mol, XLogP of 0.34, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-(hydroxymethyl)-1,2-oxazole-5-carboxylate is sourced from PubChem (CID 178200808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).