C9H13F3N2O3 — CID 178201006
N-pyrrolidin-3-ylprop-2-enamide;2,2,2-trifluoroacetic acid (PubChem CID 178201006) has the molecular formula C9H13F3N2O3 and a molecular weight of 254.21 g/mol. Its IUPAC name is N-pyrrolidin-3-ylprop-2-enamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-pyrrolidin-3-ylprop-2-enamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 178201006 |
| Molecular Formula | C9H13F3N2O3 |
| Molecular Weight | 254.21 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | N-pyrrolidin-3-ylprop-2-enamide;2,2,2-trifluoroacetic acid |
| SMILES | C=CC(=O)NC1CCNC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C7H12N2O.C2HF3O2/c1-2-7(10)9-6-3-4-8-5-6;3-2(4,5)1(6)7/h2,6,8H,1,3-5H2,(H,9,10);(H,6,7) |
| InChIKey | ZIBFQIOYHYPSDC-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.21 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|