C11H13NO — CID 178202080
(E)-3-(dimethylamino)-1-(2,3,4,5,6-pentadeuteriophenyl)prop-2-en-1-one (PubChem CID 178202080) has the molecular formula C11H13NO and a molecular weight of 180.26 g/mol. Its IUPAC name is (E)-3-(dimethylamino)-1-(2,3,4,5,6-pentadeuteriophenyl)prop-2-en-1-one.
| Compound Name | (E)-3-(dimethylamino)-1-(2,3,4,5,6-pentadeuteriophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 178202080 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 180.26 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | (E)-3-(dimethylamino)-1-(2,3,4,5,6-pentadeuteriophenyl)prop-2-en-1-one |
| SMILES | [2H]c1c([2H])c([2H])c(C(=O)/C=C/N(C)C)c([2H])c1[2H] |
| InChI | InChI=1S/C11H13NO/c1-12(2)9-8-11(13)10-6-4-3-5-7-10/h3-9H,1-2H3/b9-8+/i3D,4D,5D,6D,7D |
| InChIKey | HUTKDPINCSJXAA-VVBJMPBNSA-N |
| XLogP | 1.94 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.26 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|