C9H14F3NO2 — CID 178202342
ethyl (2R,3S)-2-(trifluoromethyl)piperidine-3-carboxylate (PubChem CID 178202342) has the molecular formula C9H14F3NO2 and a molecular weight of 225.21 g/mol. Its IUPAC name is ethyl (2R,3S)-2-(trifluoromethyl)piperidine-3-carboxylate.
| Compound Name | ethyl (2R,3S)-2-(trifluoromethyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 178202342 |
| Molecular Formula | C9H14F3NO2 |
| Molecular Weight | 225.21 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | ethyl (2R,3S)-2-(trifluoromethyl)piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCCN[C@H]1C(F)(F)F |
| InChI | InChI=1S/C9H14F3NO2/c1-2-15-8(14)6-4-3-5-13-7(6)9(10,11)12/h6-7,13H,2-5H2,1H3/t6-,7+/m0/s1 |
| InChIKey | QPXLWMZFNRHKIX-NKWVEPMBSA-N |
| XLogP | 1.48 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.21 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |