C15H10Cl2F3NO3 — CID 178202945
(3aS,4R,9bR)-6,8-dichloro-5-(2,2,2-trifluoroacetyl)-3,3a,4,9b-tetrahydrocyclopenta[c]quinoline-4-carboxylic acid (PubChem CID 178202945) has the molecular formula C15H10Cl2F3NO3 and a molecular weight of 380.15 g/mol. Its IUPAC name is (3aS,4R,9bR)-6,8-dichloro-5-(2,2,2-trifluoroacetyl)-3,3a,4,9b-tetrahydrocyclopenta[c]quinoline-4-carboxylic acid.
| Compound Name | (3aS,4R,9bR)-6,8-dichloro-5-(2,2,2-trifluoroacetyl)-3,3a,4,9b-tetrahydrocyclopenta[c]quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 178202945 |
| Molecular Formula | C15H10Cl2F3NO3 |
| Molecular Weight | 380.15 g/mol |
| Exact Mass | 379.00 |
| IUPAC Name | (3aS,4R,9bR)-6,8-dichloro-5-(2,2,2-trifluoroacetyl)-3,3a,4,9b-tetrahydrocyclopenta[c]quinoline-4-carboxylic acid |
| SMILES | O=C(O)[C@H]1[C@H]2CC=C[C@H]2c2cc(Cl)cc(Cl)c2N1C(=O)C(F)(F)F |
| InChI | InChI=1S/C15H10Cl2F3NO3/c16-6-4-9-7-2-1-3-8(7)12(13(22)23)21(11(9)10(17)5-6)14(24)15(18,19)20/h1-2,4-5,7-8,12H,3H2,(H,22,23)/t7-,8+,12-/m1/s1 |
| InChIKey | JHTVWOGYIKFHHF-RGNHYFCHSA-N |
| XLogP | 4.02 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.15 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|