C14H25NO3 — CID 178203012
tert-butyl (4aR,8aR)-8a-hydroxy-1,3,4,4a,5,6,7,8-octahydroisoquinoline-2-carboxylate (PubChem CID 178203012) has the molecular formula C14H25NO3 and a molecular weight of 255.36 g/mol. Its IUPAC name is tert-butyl (4aR,8aR)-8a-hydroxy-1,3,4,4a,5,6,7,8-octahydroisoquinoline-2-carboxylate.
| Compound Name | tert-butyl (4aR,8aR)-8a-hydroxy-1,3,4,4a,5,6,7,8-octahydroisoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 178203012 |
| Molecular Formula | C14H25NO3 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | tert-butyl (4aR,8aR)-8a-hydroxy-1,3,4,4a,5,6,7,8-octahydroisoquinoline-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H]2CCCC[C@]2(O)C1 |
| InChI | InChI=1S/C14H25NO3/c1-13(2,3)18-12(16)15-9-7-11-6-4-5-8-14(11,17)10-15/h11,17H,4-10H2,1-3H3/t11-,14+/m1/s1 |
| InChIKey | ODWZVQHNKJXXSG-RISCZKNCSA-N |
| XLogP | 2.55 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |