About N1-benzyl-N4-(1H-5-indazolyl)-1,4-cyclohexanediamine
N1-benzyl-N4-(1H-5-indazolyl)-1,4-cyclohexanediamine (PubChem CID 17838205) has the molecular formula C20H24N4
and a molecular weight of 320.40 g/mol. Its IUPAC name is 1-N-benzyl-4-N-(1H-indazol-5-yl)cyclohexane-1,4-diamine.
Molecular Properties
| Compound Name | N1-benzyl-N4-(1H-5-indazolyl)-1,4-cyclohexanediamine |
| PubChem CID | 17838205 |
| Molecular Formula | C20H24N4 |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | 1-N-benzyl-4-N-(1H-indazol-5-yl)cyclohexane-1,4-diamine |
| SMILES | C1CC(CCC1NCC2=CC=CC=C2)NC3=CC4=C(C=C3)NN=C4 |
| InChI | InChI=1S/C20H24N4/c1-2-4-15(5-3-1)13-21-17-6-8-18(9-7-17)23-19-10-11-20-16(12-19)14-22-24-20/h1-5,10-12,14,17-18,21,23H,6-9,13H2,(H,22,24) |
| InChIKey | DTWVAYWHWHWLBT-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 52.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | 374 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N1-benzyl-N4-(1H-5-indazolyl)-1,4-cyclohexanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N1-benzyl-N4-(1H-5-indazolyl)-1,4-cyclohexanediamine?
The IUPAC name of N1-benzyl-N4-(1H-5-indazolyl)-1,4-cyclohexanediamine (CID 17838205) is 1-N-benzyl-4-N-(1H-indazol-5-yl)cyclohexane-1,4-diamine.
What is the SMILES notation for N1-benzyl-N4-(1H-5-indazolyl)-1,4-cyclohexanediamine?
The canonical SMILES for N1-benzyl-N4-(1H-5-indazolyl)-1,4-cyclohexanediamine is C1CC(CCC1NCC2=CC=CC=C2)NC3=CC4=C(C=C3)NN=C4.
What is the InChIKey of N1-benzyl-N4-(1H-5-indazolyl)-1,4-cyclohexanediamine?
The InChIKey is DTWVAYWHWHWLBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24N4/c1-2-4-15(5-3-1)13-21-17-6-8-18(9-7-17)23-19-10-11-20-16(12-19)14-22-24-20/h1-5,10-12,14,17-18,21,23H,6-9,13H2,(H,22,24).
What are the key properties of N1-benzyl-N4-(1H-5-indazolyl)-1,4-cyclohexanediamine?
N1-benzyl-N4-(1H-5-indazolyl)-1,4-cyclohexanediamine has a molecular weight of 320.40 g/mol, XLogP of 3.90, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N1-benzyl-N4-(1H-5-indazolyl)-1,4-cyclohexanediamine is sourced from PubChem (CID 17838205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).