C16H14Cl2 — CID 17900569
1-(3,4-Dichlorophenyl)-1,2,3,4-tetrahydronaphthalene (PubChem CID 17900569) has the molecular formula C16H14Cl2 and a molecular weight of 277.20 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 1-(3,4-Dichlorophenyl)-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 17900569 |
| Molecular Formula | C16H14Cl2 |
| Molecular Weight | 277.20 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalene |
| SMILES | C1CC(C2=CC=CC=C2C1)C3=CC(=C(C=C3)Cl)Cl |
| InChI | InChI=1S/C16H14Cl2/c17-15-9-8-12(10-16(15)18)14-7-3-5-11-4-1-2-6-13(11)14/h1-2,4,6,8-10,14H,3,5,7H2 |
| InChIKey | PUKBOMXODMUDBW-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | 278 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.20 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |