About 4-(2,4-dichlorophenoxy)-N-[(2-ethoxyphenyl)carbamothioyl]butanamide
4-(2,4-dichlorophenoxy)-N-[(2-ethoxyphenyl)carbamothioyl]butanamide (PubChem CID 1792628) has the molecular formula C19H20Cl2N2O3S
and a molecular weight of 427.30 g/mol. Its IUPAC name is 4-(2,4-dichlorophenoxy)-N-[(2-ethoxyphenyl)carbamothioyl]butanamide.
Molecular Properties
| Compound Name | 4-(2,4-dichlorophenoxy)-N-[(2-ethoxyphenyl)carbamothioyl]butanamide |
| PubChem CID | 1792628 |
| Molecular Formula | C19H20Cl2N2O3S |
| Molecular Weight | 427.30 g/mol |
| Exact Mass | 426.06 |
| IUPAC Name | 4-(2,4-dichlorophenoxy)-N-[(2-ethoxyphenyl)carbamothioyl]butanamide |
| SMILES | CCOC1=CC=CC=C1NC(=S)NC(=O)CCCOC2=C(C=C(C=C2)Cl)Cl |
| InChI | InChI=1S/C19H20Cl2N2O3S/c1-2-25-17-7-4-3-6-15(17)22-19(27)23-18(24)8-5-11-26-16-10-9-13(20)12-14(16)21/h3-4,6-7,9-10,12H,2,5,8,11H2,1H3,(H2,22,23,24,27) |
| InChIKey | XMIZVTAXLCSDOX-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 91.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | 484 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 427.30 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,4-dichlorophenoxy)-N-[(2-ethoxyphenyl)carbamothioyl]butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,4-dichlorophenoxy)-N-[(2-ethoxyphenyl)carbamothioyl]butanamide?
The IUPAC name of 4-(2,4-dichlorophenoxy)-N-[(2-ethoxyphenyl)carbamothioyl]butanamide (CID 1792628) is 4-(2,4-dichlorophenoxy)-N-[(2-ethoxyphenyl)carbamothioyl]butanamide.
What is the SMILES notation for 4-(2,4-dichlorophenoxy)-N-[(2-ethoxyphenyl)carbamothioyl]butanamide?
The canonical SMILES for 4-(2,4-dichlorophenoxy)-N-[(2-ethoxyphenyl)carbamothioyl]butanamide is CCOC1=CC=CC=C1NC(=S)NC(=O)CCCOC2=C(C=C(C=C2)Cl)Cl.
What is the InChIKey of 4-(2,4-dichlorophenoxy)-N-[(2-ethoxyphenyl)carbamothioyl]butanamide?
The InChIKey is XMIZVTAXLCSDOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20Cl2N2O3S/c1-2-25-17-7-4-3-6-15(17)22-19(27)23-18(24)8-5-11-26-16-10-9-13(20)12-14(16)21/h3-4,6-7,9-10,12H,2,5,8,11H2,1H3,(H2,22,23,24,27).
What are the key properties of 4-(2,4-dichlorophenoxy)-N-[(2-ethoxyphenyl)carbamothioyl]butanamide?
4-(2,4-dichlorophenoxy)-N-[(2-ethoxyphenyl)carbamothioyl]butanamide has a molecular weight of 427.30 g/mol, XLogP of 5.40, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,4-dichlorophenoxy)-N-[(2-ethoxyphenyl)carbamothioyl]butanamide is sourced from PubChem (CID 1792628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).