About 2,5-dichlorobenzoyl chloride
2,5-dichlorobenzoyl chloride (PubChem CID 17945) has the molecular formula C7H3Cl3O
and a molecular weight of 209.46 g/mol. Its IUPAC name is 2,5-dichlorobenzoyl chloride.
Molecular Properties
| Compound Name | 2,5-dichlorobenzoyl chloride |
| PubChem CID | 17945 |
| Molecular Formula | C7H3Cl3O |
| Molecular Weight | 209.46 g/mol |
| Exact Mass | 207.92 |
| IUPAC Name | 2,5-dichlorobenzoyl chloride |
| SMILES | O=C(Cl)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C7H3Cl3O/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3H |
| InChIKey | RSINFFVFOTUDEC-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.46 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 2,5-dichlorobenzoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dichlorobenzoyl chloride?
The IUPAC name of 2,5-dichlorobenzoyl chloride (CID 17945) is 2,5-dichlorobenzoyl chloride.
What is the SMILES notation for 2,5-dichlorobenzoyl chloride?
The canonical SMILES for 2,5-dichlorobenzoyl chloride is O=C(Cl)c1cc(Cl)ccc1Cl.
What is the InChIKey of 2,5-dichlorobenzoyl chloride?
The InChIKey is RSINFFVFOTUDEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3Cl3O/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3H.
What are the key properties of 2,5-dichlorobenzoyl chloride?
2,5-dichlorobenzoyl chloride has a molecular weight of 209.46 g/mol, XLogP of 3.37, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dichlorobenzoyl chloride is sourced from PubChem (CID 17945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).