About Cyclopropylmethyl-4-amino-1-piperidine carboxylate
Cyclopropylmethyl-4-amino-1-piperidine carboxylate (PubChem CID 17952624) has the molecular formula C10H18N2O2
and a molecular weight of 198.26 g/mol. Its IUPAC name is cyclopropylmethyl 4-aminopiperidine-1-carboxylate.
Molecular Properties
| Compound Name | Cyclopropylmethyl-4-amino-1-piperidine carboxylate |
| PubChem CID | 17952624 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | cyclopropylmethyl 4-aminopiperidine-1-carboxylate |
| SMILES | C1CC1COC(=O)N2CCC(CC2)N |
| InChI | InChI=1S/C10H18N2O2/c11-9-3-5-12(6-4-9)10(13)14-7-8-1-2-8/h8-9H,1-7,11H2 |
| InChIKey | IMHJLROTXPCEIZ-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 55.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | 208 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze Cyclopropylmethyl-4-amino-1-piperidine carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Cyclopropylmethyl-4-amino-1-piperidine carboxylate?
The IUPAC name of Cyclopropylmethyl-4-amino-1-piperidine carboxylate (CID 17952624) is cyclopropylmethyl 4-aminopiperidine-1-carboxylate.
What is the SMILES notation for Cyclopropylmethyl-4-amino-1-piperidine carboxylate?
The canonical SMILES for Cyclopropylmethyl-4-amino-1-piperidine carboxylate is C1CC1COC(=O)N2CCC(CC2)N.
What is the InChIKey of Cyclopropylmethyl-4-amino-1-piperidine carboxylate?
The InChIKey is IMHJLROTXPCEIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O2/c11-9-3-5-12(6-4-9)10(13)14-7-8-1-2-8/h8-9H,1-7,11H2.
What are the key properties of Cyclopropylmethyl-4-amino-1-piperidine carboxylate?
Cyclopropylmethyl-4-amino-1-piperidine carboxylate has a molecular weight of 198.26 g/mol, XLogP of 0.50, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for Cyclopropylmethyl-4-amino-1-piperidine carboxylate is sourced from PubChem (CID 17952624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).