About (1-methylpiperidin-1-ium-4-yl) 2-methoxy-2,2-diphenylacetate chloride
(1-methylpiperidin-1-ium-4-yl) 2-methoxy-2,2-diphenylacetate chloride (PubChem CID 17973) has the molecular formula C21H26ClNO3
and a molecular weight of 375.90 g/mol. Its IUPAC name is (1-methylpiperidin-1-ium-4-yl) 2-methoxy-2,2-diphenylacetate chloride.
Molecular Properties
| Compound Name | (1-methylpiperidin-1-ium-4-yl) 2-methoxy-2,2-diphenylacetate chloride |
| PubChem CID | 17973 |
| Molecular Formula | C21H26ClNO3 |
| Molecular Weight | 375.90 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | (1-methylpiperidin-1-ium-4-yl) 2-methoxy-2,2-diphenylacetate chloride |
| SMILES | COC(C(=O)OC1CC[NH+](C)CC1)(c1ccccc1)c1ccccc1.[Cl-] |
| InChI | InChI=1S/C21H25NO3.ClH/c1-22-15-13-19(14-16-22)25-20(23)21(24-2,17-9-5-3-6-10-17)18-11-7-4-8-12-18;/h3-12,19H,13-16H2,1-2H3;1H |
| InChIKey | QPKXEEYVMNDLBQ-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 39.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.90 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1-methylpiperidin-1-ium-4-yl) 2-methoxy-2,2-diphenylacetate chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methylpiperidin-1-ium-4-yl) 2-methoxy-2,2-diphenylacetate chloride?
The IUPAC name of (1-methylpiperidin-1-ium-4-yl) 2-methoxy-2,2-diphenylacetate chloride (CID 17973) is (1-methylpiperidin-1-ium-4-yl) 2-methoxy-2,2-diphenylacetate chloride.
What is the SMILES notation for (1-methylpiperidin-1-ium-4-yl) 2-methoxy-2,2-diphenylacetate chloride?
The canonical SMILES for (1-methylpiperidin-1-ium-4-yl) 2-methoxy-2,2-diphenylacetate chloride is COC(C(=O)OC1CC[NH+](C)CC1)(c1ccccc1)c1ccccc1.[Cl-].
What is the InChIKey of (1-methylpiperidin-1-ium-4-yl) 2-methoxy-2,2-diphenylacetate chloride?
The InChIKey is QPKXEEYVMNDLBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25NO3.ClH/c1-22-15-13-19(14-16-22)25-20(23)21(24-2,17-9-5-3-6-10-17)18-11-7-4-8-12-18;/h3-12,19H,13-16H2,1-2H3;1H.
What are the key properties of (1-methylpiperidin-1-ium-4-yl) 2-methoxy-2,2-diphenylacetate chloride?
(1-methylpiperidin-1-ium-4-yl) 2-methoxy-2,2-diphenylacetate chloride has a molecular weight of 375.90 g/mol, XLogP of -1.20, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylpiperidin-1-ium-4-yl) 2-methoxy-2,2-diphenylacetate chloride is sourced from PubChem (CID 17973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).