C9H17NO — CID 18000069
2-(hepta-1,6-dien-4-ylamino)ethanol (PubChem CID 18000069) has the molecular formula C9H17NO and a molecular weight of 155.24 g/mol. Its IUPAC name is 2-(hepta-1,6-dien-4-ylamino)ethanol.
| Compound Name | 2-(hepta-1,6-dien-4-ylamino)ethanol |
|---|---|
| PubChem CID | 18000069 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.13 |
| IUPAC Name | 2-(hepta-1,6-dien-4-ylamino)ethanol |
| SMILES | C=CCC(CC=C)NCCO |
| InChI | InChI=1S/C9H17NO/c1-3-5-9(6-4-2)10-7-8-11/h3-4,9-11H,1-2,5-8H2 |
| InChIKey | ZAYHFJWSDOOOSR-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|