About 2,3-dihydrophthalazin-5-ol
2,3-dihydrophthalazin-5-ol (PubChem CID 18000385) has the molecular formula C8H8N2O
and a molecular weight of 148.16 g/mol. Its IUPAC name is 2,3-dihydrophthalazin-5-ol.
Molecular Properties
| Compound Name | 2,3-dihydrophthalazin-5-ol |
| PubChem CID | 18000385 |
| Molecular Formula | C8H8N2O |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.06 |
| IUPAC Name | 2,3-dihydrophthalazin-5-ol |
| SMILES | Oc1cccc2c1=CNNC=2 |
| InChI | InChI=1S/C8H8N2O/c11-8-3-1-2-6-4-9-10-5-7(6)8/h1-5,9-11H |
| InChIKey | VWKWTBDNYUHGGD-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,3-dihydrophthalazin-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydrophthalazin-5-ol?
The IUPAC name of 2,3-dihydrophthalazin-5-ol (CID 18000385) is 2,3-dihydrophthalazin-5-ol.
What is the SMILES notation for 2,3-dihydrophthalazin-5-ol?
The canonical SMILES for 2,3-dihydrophthalazin-5-ol is Oc1cccc2c1=CNNC=2.
What is the InChIKey of 2,3-dihydrophthalazin-5-ol?
The InChIKey is VWKWTBDNYUHGGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O/c11-8-3-1-2-6-4-9-10-5-7(6)8/h1-5,9-11H.
What are the key properties of 2,3-dihydrophthalazin-5-ol?
2,3-dihydrophthalazin-5-ol has a molecular weight of 148.16 g/mol, XLogP of -1.02, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydrophthalazin-5-ol is sourced from PubChem (CID 18000385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).