C14H21NO6 — CID 18000505
benzyl(trimethyl)azanium;2,3,4-trihydroxy-4-oxobutanoate (PubChem CID 18000505) has the molecular formula C14H21NO6 and a molecular weight of 299.32 g/mol. Its IUPAC name is benzyl(trimethyl)azanium;2,3,4-trihydroxy-4-oxobutanoate.
| Compound Name | benzyl(trimethyl)azanium;2,3,4-trihydroxy-4-oxobutanoate |
|---|---|
| PubChem CID | 18000505 |
| Molecular Formula | C14H21NO6 |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | benzyl(trimethyl)azanium;2,3,4-trihydroxy-4-oxobutanoate |
| SMILES | C[N+](C)(C)Cc1ccccc1.O=C([O-])C(O)C(O)C(=O)O |
| InChI | InChI=1S/C10H16N.C4H6O6/c1-11(2,3)9-10-7-5-4-6-8-10;5-1(3(7)8)2(6)4(9)10/h4-8H,9H2,1-3H3;1-2,5-6H,(H,7,8)(H,9,10)/q+1;/p-1 |
| InChIKey | NZZOHLWKVHAZRI-UHFFFAOYSA-M |
| XLogP | -1.56 |
| TPSA | 117.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|