About carbonic acid;dimethyl carbonate;methoxymethane
carbonic acid;dimethyl carbonate;methoxymethane (PubChem CID 18000522) has the molecular formula C6H14O7
and a molecular weight of 198.17 g/mol. Its IUPAC name is carbonic acid;dimethyl carbonate;methoxymethane.
Molecular Properties
| Compound Name | carbonic acid;dimethyl carbonate;methoxymethane |
| PubChem CID | 18000522 |
| Molecular Formula | C6H14O7 |
| Molecular Weight | 198.17 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | carbonic acid;dimethyl carbonate;methoxymethane |
| SMILES | COC.COC(=O)OC.O=C(O)O |
| InChI | InChI=1S/C3H6O3.C2H6O.CH2O3/c1-5-3(4)6-2;1-3-2;2-1(3)4/h1-2H3;1-2H3;(H2,2,3,4) |
| InChIKey | VCGRSVACRAUXJK-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.17 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze carbonic acid;dimethyl carbonate;methoxymethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbonic acid;dimethyl carbonate;methoxymethane?
The IUPAC name of carbonic acid;dimethyl carbonate;methoxymethane (CID 18000522) is carbonic acid;dimethyl carbonate;methoxymethane.
What is the SMILES notation for carbonic acid;dimethyl carbonate;methoxymethane?
The canonical SMILES for carbonic acid;dimethyl carbonate;methoxymethane is COC.COC(=O)OC.O=C(O)O.
What is the InChIKey of carbonic acid;dimethyl carbonate;methoxymethane?
The InChIKey is VCGRSVACRAUXJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O3.C2H6O.CH2O3/c1-5-3(4)6-2;1-3-2;2-1(3)4/h1-2H3;1-2H3;(H2,2,3,4).
What are the key properties of carbonic acid;dimethyl carbonate;methoxymethane?
carbonic acid;dimethyl carbonate;methoxymethane has a molecular weight of 198.17 g/mol, XLogP of 0.88, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for carbonic acid;dimethyl carbonate;methoxymethane is sourced from PubChem (CID 18000522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).