About naphthalen-1-ylsulfonyloxymethyl naphthalene-1-sulfonate
naphthalen-1-ylsulfonyloxymethyl naphthalene-1-sulfonate (PubChem CID 18000678) has the molecular formula C21H16O6S2
and a molecular weight of 428.49 g/mol. Its IUPAC name is naphthalen-1-ylsulfonyloxymethyl naphthalene-1-sulfonate.
Molecular Properties
| Compound Name | naphthalen-1-ylsulfonyloxymethyl naphthalene-1-sulfonate |
| PubChem CID | 18000678 |
| Molecular Formula | C21H16O6S2 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.04 |
| IUPAC Name | naphthalen-1-ylsulfonyloxymethyl naphthalene-1-sulfonate |
| SMILES | O=S(=O)(OCOS(=O)(=O)c1cccc2ccccc12)c1cccc2ccccc12 |
| InChI | InChI=1S/C21H16O6S2/c22-28(23,20-13-5-9-16-7-1-3-11-18(16)20)26-15-27-29(24,25)21-14-6-10-17-8-2-4-12-19(17)21/h1-14H,15H2 |
| InChIKey | VORRFUUQXVSQOQ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze naphthalen-1-ylsulfonyloxymethyl naphthalene-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalen-1-ylsulfonyloxymethyl naphthalene-1-sulfonate?
The IUPAC name of naphthalen-1-ylsulfonyloxymethyl naphthalene-1-sulfonate (CID 18000678) is naphthalen-1-ylsulfonyloxymethyl naphthalene-1-sulfonate.
What is the SMILES notation for naphthalen-1-ylsulfonyloxymethyl naphthalene-1-sulfonate?
The canonical SMILES for naphthalen-1-ylsulfonyloxymethyl naphthalene-1-sulfonate is O=S(=O)(OCOS(=O)(=O)c1cccc2ccccc12)c1cccc2ccccc12.
What is the InChIKey of naphthalen-1-ylsulfonyloxymethyl naphthalene-1-sulfonate?
The InChIKey is VORRFUUQXVSQOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16O6S2/c22-28(23,20-13-5-9-16-7-1-3-11-18(16)20)26-15-27-29(24,25)21-14-6-10-17-8-2-4-12-19(17)21/h1-14H,15H2.
What are the key properties of naphthalen-1-ylsulfonyloxymethyl naphthalene-1-sulfonate?
naphthalen-1-ylsulfonyloxymethyl naphthalene-1-sulfonate has a molecular weight of 428.49 g/mol, XLogP of 4.06, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalen-1-ylsulfonyloxymethyl naphthalene-1-sulfonate is sourced from PubChem (CID 18000678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).