About 3-cyano-1,2,4-triazole-3-carboxylic acid
3-cyano-1,2,4-triazole-3-carboxylic acid (PubChem CID 18000717) has the molecular formula C4H2N4O2
and a molecular weight of 138.09 g/mol. Its IUPAC name is 3-cyano-1,2,4-triazole-3-carboxylic acid.
Molecular Properties
| Compound Name | 3-cyano-1,2,4-triazole-3-carboxylic acid |
| PubChem CID | 18000717 |
| Molecular Formula | C4H2N4O2 |
| Molecular Weight | 138.09 g/mol |
| Exact Mass | 138.02 |
| IUPAC Name | 3-cyano-1,2,4-triazole-3-carboxylic acid |
| SMILES | N#CC1(C(=O)O)N=CN=N1 |
| InChI | InChI=1S/C4H2N4O2/c5-1-4(3(9)10)6-2-7-8-4/h2H,(H,9,10) |
| InChIKey | PYQJYIXJOSJGPY-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 98.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.09 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-cyano-1,2,4-triazole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyano-1,2,4-triazole-3-carboxylic acid?
The IUPAC name of 3-cyano-1,2,4-triazole-3-carboxylic acid (CID 18000717) is 3-cyano-1,2,4-triazole-3-carboxylic acid.
What is the SMILES notation for 3-cyano-1,2,4-triazole-3-carboxylic acid?
The canonical SMILES for 3-cyano-1,2,4-triazole-3-carboxylic acid is N#CC1(C(=O)O)N=CN=N1.
What is the InChIKey of 3-cyano-1,2,4-triazole-3-carboxylic acid?
The InChIKey is PYQJYIXJOSJGPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2N4O2/c5-1-4(3(9)10)6-2-7-8-4/h2H,(H,9,10).
What are the key properties of 3-cyano-1,2,4-triazole-3-carboxylic acid?
3-cyano-1,2,4-triazole-3-carboxylic acid has a molecular weight of 138.09 g/mol, XLogP of -0.22, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyano-1,2,4-triazole-3-carboxylic acid is sourced from PubChem (CID 18000717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).