C17H15BrClFN2O3 — CID 18000995
5-(3-bromo-4-fluorophenyl)-1,5,7,8,9,10-hexahydropyrano[3,4-b][1,7]naphthyridine-4,6-dione;hydrochloride (PubChem CID 18000995) has the molecular formula C17H15BrClFN2O3 and a molecular weight of 429.67 g/mol. Its IUPAC name is 5-(3-bromo-4-fluorophenyl)-1,5,7,8,9,10-hexahydropyrano[3,4-b][1,7]naphthyridine-4,6-dione;hydrochloride.
| Compound Name | 5-(3-bromo-4-fluorophenyl)-1,5,7,8,9,10-hexahydropyrano[3,4-b][1,7]naphthyridine-4,6-dione;hydrochloride |
|---|---|
| PubChem CID | 18000995 |
| Molecular Formula | C17H15BrClFN2O3 |
| Molecular Weight | 429.67 g/mol |
| Exact Mass | 427.99 |
| IUPAC Name | 5-(3-bromo-4-fluorophenyl)-1,5,7,8,9,10-hexahydropyrano[3,4-b][1,7]naphthyridine-4,6-dione;hydrochloride |
| SMILES | Cl.O=C1CNCC2=C1C(c1ccc(F)c(Br)c1)C1=C(COCC1=O)N2 |
| InChI | InChI=1S/C17H14BrFN2O3.ClH/c18-9-3-8(1-2-10(9)19)15-16-11(4-20-5-13(16)22)21-12-6-24-7-14(23)17(12)15;/h1-3,15,20-21H,4-7H2;1H |
| InChIKey | WYFVELCOEXSMSH-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.67 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |