About 4-ethylimidazo[1,2-a]pyridin-4-ium
4-ethylimidazo[1,2-a]pyridin-4-ium (PubChem CID 18001023) has the molecular formula C9H11N2+
and a molecular weight of 147.20 g/mol. Its IUPAC name is 4-ethylimidazo[1,2-a]pyridin-4-ium.
Molecular Properties
| Compound Name | 4-ethylimidazo[1,2-a]pyridin-4-ium |
| PubChem CID | 18001023 |
| Molecular Formula | C9H11N2+ |
| Molecular Weight | 147.20 g/mol |
| Exact Mass | 147.09 |
| IUPAC Name | 4-ethylimidazo[1,2-a]pyridin-4-ium |
| SMILES | CC[N+]12C=CC=CC1=NC=C2 |
| InChI | InChI=1S/C9H11N2/c1-2-11-7-4-3-5-9(11)10-6-8-11/h3-8H,2H2,1H3/q+1 |
| InChIKey | FAAOZQAFKCWJSK-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.20 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 4-ethylimidazo[1,2-a]pyridin-4-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethylimidazo[1,2-a]pyridin-4-ium?
The IUPAC name of 4-ethylimidazo[1,2-a]pyridin-4-ium (CID 18001023) is 4-ethylimidazo[1,2-a]pyridin-4-ium.
What is the SMILES notation for 4-ethylimidazo[1,2-a]pyridin-4-ium?
The canonical SMILES for 4-ethylimidazo[1,2-a]pyridin-4-ium is CC[N+]12C=CC=CC1=NC=C2.
What is the InChIKey of 4-ethylimidazo[1,2-a]pyridin-4-ium?
The InChIKey is FAAOZQAFKCWJSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N2/c1-2-11-7-4-3-5-9(11)10-6-8-11/h3-8H,2H2,1H3/q+1.
What are the key properties of 4-ethylimidazo[1,2-a]pyridin-4-ium?
4-ethylimidazo[1,2-a]pyridin-4-ium has a molecular weight of 147.20 g/mol, XLogP of 1.79, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethylimidazo[1,2-a]pyridin-4-ium is sourced from PubChem (CID 18001023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).