About 2,4-diphenyl-1,2-dihydropyridine
2,4-diphenyl-1,2-dihydropyridine (PubChem CID 18001057) has the molecular formula C17H15N
and a molecular weight of 233.31 g/mol. Its IUPAC name is 2,4-diphenyl-1,2-dihydropyridine.
Molecular Properties
| Compound Name | 2,4-diphenyl-1,2-dihydropyridine |
| PubChem CID | 18001057 |
| Molecular Formula | C17H15N |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 2,4-diphenyl-1,2-dihydropyridine |
| SMILES | C1=CC(c2ccccc2)=CC(c2ccccc2)N1 |
| InChI | InChI=1S/C17H15N/c1-3-7-14(8-4-1)16-11-12-18-17(13-16)15-9-5-2-6-10-15/h1-13,17-18H |
| InChIKey | XISWVMFXJZQUER-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,4-diphenyl-1,2-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-diphenyl-1,2-dihydropyridine?
The IUPAC name of 2,4-diphenyl-1,2-dihydropyridine (CID 18001057) is 2,4-diphenyl-1,2-dihydropyridine.
What is the SMILES notation for 2,4-diphenyl-1,2-dihydropyridine?
The canonical SMILES for 2,4-diphenyl-1,2-dihydropyridine is C1=CC(c2ccccc2)=CC(c2ccccc2)N1.
What is the InChIKey of 2,4-diphenyl-1,2-dihydropyridine?
The InChIKey is XISWVMFXJZQUER-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15N/c1-3-7-14(8-4-1)16-11-12-18-17(13-16)15-9-5-2-6-10-15/h1-13,17-18H.
What are the key properties of 2,4-diphenyl-1,2-dihydropyridine?
2,4-diphenyl-1,2-dihydropyridine has a molecular weight of 233.31 g/mol, XLogP of 3.93, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-diphenyl-1,2-dihydropyridine is sourced from PubChem (CID 18001057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).