About 3-bromo-7-(1,1-dimethoxyethyl)imidazo[1,2-a]pyrimidine
3-bromo-7-(1,1-dimethoxyethyl)imidazo[1,2-a]pyrimidine (PubChem CID 18001292) has the molecular formula C10H12BrN3O2
and a molecular weight of 286.13 g/mol. Its IUPAC name is 3-bromo-7-(1,1-dimethoxyethyl)imidazo[1,2-a]pyrimidine.
Molecular Properties
| Compound Name | 3-bromo-7-(1,1-dimethoxyethyl)imidazo[1,2-a]pyrimidine |
| PubChem CID | 18001292 |
| Molecular Formula | C10H12BrN3O2 |
| Molecular Weight | 286.13 g/mol |
| Exact Mass | 285.01 |
| IUPAC Name | 3-bromo-7-(1,1-dimethoxyethyl)imidazo[1,2-a]pyrimidine |
| SMILES | COC(C)(OC)c1ccn2c(Br)cnc2n1 |
| InChI | InChI=1S/C10H12BrN3O2/c1-10(15-2,16-3)7-4-5-14-8(11)6-12-9(14)13-7/h4-6H,1-3H3 |
| InChIKey | KTVVQVFMQGUGRM-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 48.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.13 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-7-(1,1-dimethoxyethyl)imidazo[1,2-a]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-7-(1,1-dimethoxyethyl)imidazo[1,2-a]pyrimidine?
The IUPAC name of 3-bromo-7-(1,1-dimethoxyethyl)imidazo[1,2-a]pyrimidine (CID 18001292) is 3-bromo-7-(1,1-dimethoxyethyl)imidazo[1,2-a]pyrimidine.
What is the SMILES notation for 3-bromo-7-(1,1-dimethoxyethyl)imidazo[1,2-a]pyrimidine?
The canonical SMILES for 3-bromo-7-(1,1-dimethoxyethyl)imidazo[1,2-a]pyrimidine is COC(C)(OC)c1ccn2c(Br)cnc2n1.
What is the InChIKey of 3-bromo-7-(1,1-dimethoxyethyl)imidazo[1,2-a]pyrimidine?
The InChIKey is KTVVQVFMQGUGRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12BrN3O2/c1-10(15-2,16-3)7-4-5-14-8(11)6-12-9(14)13-7/h4-6H,1-3H3.
What are the key properties of 3-bromo-7-(1,1-dimethoxyethyl)imidazo[1,2-a]pyrimidine?
3-bromo-7-(1,1-dimethoxyethyl)imidazo[1,2-a]pyrimidine has a molecular weight of 286.13 g/mol, XLogP of 1.96, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-7-(1,1-dimethoxyethyl)imidazo[1,2-a]pyrimidine is sourced from PubChem (CID 18001292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).