About 9-(1-cyclopropylbutyl)-8-ethyl-6-(2,4,6-trimethylphenyl)purine
9-(1-cyclopropylbutyl)-8-ethyl-6-(2,4,6-trimethylphenyl)purine (PubChem CID 18001417) has the molecular formula C23H30N4
and a molecular weight of 362.52 g/mol. Its IUPAC name is 9-(1-cyclopropylbutyl)-8-ethyl-6-(2,4,6-trimethylphenyl)purine.
Molecular Properties
| Compound Name | 9-(1-cyclopropylbutyl)-8-ethyl-6-(2,4,6-trimethylphenyl)purine |
| PubChem CID | 18001417 |
| Molecular Formula | C23H30N4 |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | 9-(1-cyclopropylbutyl)-8-ethyl-6-(2,4,6-trimethylphenyl)purine |
| SMILES | CCCC(C1CC1)n1c(CC)nc2c(-c3c(C)cc(C)cc3C)ncnc21 |
| InChI | InChI=1S/C23H30N4/c1-6-8-18(17-9-10-17)27-19(7-2)26-22-21(24-13-25-23(22)27)20-15(4)11-14(3)12-16(20)5/h11-13,17-18H,6-10H2,1-5H3 |
| InChIKey | ATDGIPDCLAQXLP-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 9-(1-cyclopropylbutyl)-8-ethyl-6-(2,4,6-trimethylphenyl)purine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(1-cyclopropylbutyl)-8-ethyl-6-(2,4,6-trimethylphenyl)purine?
The IUPAC name of 9-(1-cyclopropylbutyl)-8-ethyl-6-(2,4,6-trimethylphenyl)purine (CID 18001417) is 9-(1-cyclopropylbutyl)-8-ethyl-6-(2,4,6-trimethylphenyl)purine.
What is the SMILES notation for 9-(1-cyclopropylbutyl)-8-ethyl-6-(2,4,6-trimethylphenyl)purine?
The canonical SMILES for 9-(1-cyclopropylbutyl)-8-ethyl-6-(2,4,6-trimethylphenyl)purine is CCCC(C1CC1)n1c(CC)nc2c(-c3c(C)cc(C)cc3C)ncnc21.
What is the InChIKey of 9-(1-cyclopropylbutyl)-8-ethyl-6-(2,4,6-trimethylphenyl)purine?
The InChIKey is ATDGIPDCLAQXLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H30N4/c1-6-8-18(17-9-10-17)27-19(7-2)26-22-21(24-13-25-23(22)27)20-15(4)11-14(3)12-16(20)5/h11-13,17-18H,6-10H2,1-5H3.
What are the key properties of 9-(1-cyclopropylbutyl)-8-ethyl-6-(2,4,6-trimethylphenyl)purine?
9-(1-cyclopropylbutyl)-8-ethyl-6-(2,4,6-trimethylphenyl)purine has a molecular weight of 362.52 g/mol, XLogP of 5.73, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(1-cyclopropylbutyl)-8-ethyl-6-(2,4,6-trimethylphenyl)purine is sourced from PubChem (CID 18001417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).