About 7-(2,4-dichlorophenyl)-2-ethyl-3-pentan-3-ylimidazo[4,5-b]pyridine
7-(2,4-dichlorophenyl)-2-ethyl-3-pentan-3-ylimidazo[4,5-b]pyridine (PubChem CID 18001593) has the molecular formula C19H21Cl2N3
and a molecular weight of 362.30 g/mol. Its IUPAC name is 7-(2,4-dichlorophenyl)-2-ethyl-3-pentan-3-ylimidazo[4,5-b]pyridine.
Molecular Properties
| Compound Name | 7-(2,4-dichlorophenyl)-2-ethyl-3-pentan-3-ylimidazo[4,5-b]pyridine |
| PubChem CID | 18001593 |
| Molecular Formula | C19H21Cl2N3 |
| Molecular Weight | 362.30 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 7-(2,4-dichlorophenyl)-2-ethyl-3-pentan-3-ylimidazo[4,5-b]pyridine |
| SMILES | CCc1nc2c(-c3ccc(Cl)cc3Cl)ccnc2n1C(CC)CC |
| InChI | InChI=1S/C19H21Cl2N3/c1-4-13(5-2)24-17(6-3)23-18-15(9-10-22-19(18)24)14-8-7-12(20)11-16(14)21/h7-11,13H,4-6H2,1-3H3 |
| InChIKey | OBCIACTZSKCORZ-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.30 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-(2,4-dichlorophenyl)-2-ethyl-3-pentan-3-ylimidazo[4,5-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(2,4-dichlorophenyl)-2-ethyl-3-pentan-3-ylimidazo[4,5-b]pyridine?
The IUPAC name of 7-(2,4-dichlorophenyl)-2-ethyl-3-pentan-3-ylimidazo[4,5-b]pyridine (CID 18001593) is 7-(2,4-dichlorophenyl)-2-ethyl-3-pentan-3-ylimidazo[4,5-b]pyridine.
What is the SMILES notation for 7-(2,4-dichlorophenyl)-2-ethyl-3-pentan-3-ylimidazo[4,5-b]pyridine?
The canonical SMILES for 7-(2,4-dichlorophenyl)-2-ethyl-3-pentan-3-ylimidazo[4,5-b]pyridine is CCc1nc2c(-c3ccc(Cl)cc3Cl)ccnc2n1C(CC)CC.
What is the InChIKey of 7-(2,4-dichlorophenyl)-2-ethyl-3-pentan-3-ylimidazo[4,5-b]pyridine?
The InChIKey is OBCIACTZSKCORZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21Cl2N3/c1-4-13(5-2)24-17(6-3)23-18-15(9-10-22-19(18)24)14-8-7-12(20)11-16(14)21/h7-11,13H,4-6H2,1-3H3.
What are the key properties of 7-(2,4-dichlorophenyl)-2-ethyl-3-pentan-3-ylimidazo[4,5-b]pyridine?
7-(2,4-dichlorophenyl)-2-ethyl-3-pentan-3-ylimidazo[4,5-b]pyridine has a molecular weight of 362.30 g/mol, XLogP of 6.33, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(2,4-dichlorophenyl)-2-ethyl-3-pentan-3-ylimidazo[4,5-b]pyridine is sourced from PubChem (CID 18001593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).