About 4-(azetidin-3-yl)-3,5-dimethylmorpholine
4-(azetidin-3-yl)-3,5-dimethylmorpholine (PubChem CID 18002289) has the molecular formula C9H18N2O
and a molecular weight of 170.26 g/mol. Its IUPAC name is 4-(azetidin-3-yl)-3,5-dimethylmorpholine.
Molecular Properties
| Compound Name | 4-(azetidin-3-yl)-3,5-dimethylmorpholine |
| PubChem CID | 18002289 |
| Molecular Formula | C9H18N2O |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.14 |
| IUPAC Name | 4-(azetidin-3-yl)-3,5-dimethylmorpholine |
| SMILES | CC1COCC(C)N1C1CNC1 |
| InChI | InChI=1S/C9H18N2O/c1-7-5-12-6-8(2)11(7)9-3-10-4-9/h7-10H,3-6H2,1-2H3 |
| InChIKey | BKBZTIOBCUISCB-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(azetidin-3-yl)-3,5-dimethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(azetidin-3-yl)-3,5-dimethylmorpholine?
The IUPAC name of 4-(azetidin-3-yl)-3,5-dimethylmorpholine (CID 18002289) is 4-(azetidin-3-yl)-3,5-dimethylmorpholine.
What is the SMILES notation for 4-(azetidin-3-yl)-3,5-dimethylmorpholine?
The canonical SMILES for 4-(azetidin-3-yl)-3,5-dimethylmorpholine is CC1COCC(C)N1C1CNC1.
What is the InChIKey of 4-(azetidin-3-yl)-3,5-dimethylmorpholine?
The InChIKey is BKBZTIOBCUISCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O/c1-7-5-12-6-8(2)11(7)9-3-10-4-9/h7-10H,3-6H2,1-2H3.
What are the key properties of 4-(azetidin-3-yl)-3,5-dimethylmorpholine?
4-(azetidin-3-yl)-3,5-dimethylmorpholine has a molecular weight of 170.26 g/mol, XLogP of 0.07, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(azetidin-3-yl)-3,5-dimethylmorpholine is sourced from PubChem (CID 18002289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).