About (E)-5,8-dihydroxydodec-6-ene-4,9-dione
(E)-5,8-dihydroxydodec-6-ene-4,9-dione (PubChem CID 18002495) has the molecular formula C12H20O4
and a molecular weight of 228.29 g/mol. Its IUPAC name is (E)-5,8-dihydroxydodec-6-ene-4,9-dione.
Molecular Properties
| Compound Name | (E)-5,8-dihydroxydodec-6-ene-4,9-dione |
| PubChem CID | 18002495 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | (E)-5,8-dihydroxydodec-6-ene-4,9-dione |
| SMILES | CCCC(=O)C(O)/C=C/C(O)C(=O)CCC |
| InChI | InChI=1S/C12H20O4/c1-3-5-9(13)11(15)7-8-12(16)10(14)6-4-2/h7-8,11-12,15-16H,3-6H2,1-2H3/b8-7+ |
| InChIKey | BYMGXIIKJHNEKD-BQYQJAHWSA-N |
| XLogP | 1.00 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-5,8-dihydroxydodec-6-ene-4,9-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-5,8-dihydroxydodec-6-ene-4,9-dione?
The IUPAC name of (E)-5,8-dihydroxydodec-6-ene-4,9-dione (CID 18002495) is (E)-5,8-dihydroxydodec-6-ene-4,9-dione.
What is the SMILES notation for (E)-5,8-dihydroxydodec-6-ene-4,9-dione?
The canonical SMILES for (E)-5,8-dihydroxydodec-6-ene-4,9-dione is CCCC(=O)C(O)/C=C/C(O)C(=O)CCC.
What is the InChIKey of (E)-5,8-dihydroxydodec-6-ene-4,9-dione?
The InChIKey is BYMGXIIKJHNEKD-BQYQJAHWSA-N. The full InChI is InChI=1S/C12H20O4/c1-3-5-9(13)11(15)7-8-12(16)10(14)6-4-2/h7-8,11-12,15-16H,3-6H2,1-2H3/b8-7+.
What are the key properties of (E)-5,8-dihydroxydodec-6-ene-4,9-dione?
(E)-5,8-dihydroxydodec-6-ene-4,9-dione has a molecular weight of 228.29 g/mol, XLogP of 1.00, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-5,8-dihydroxydodec-6-ene-4,9-dione is sourced from PubChem (CID 18002495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).