C22H18ClN3O — CID 18002648
1-(3-chlorophenyl)-3-(3-pyridin-4-ylpropyl)-1,8-naphthyridin-2-one (PubChem CID 18002648) has the molecular formula C22H18ClN3O and a molecular weight of 375.86 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-(3-pyridin-4-ylpropyl)-1,8-naphthyridin-2-one.
| Compound Name | 1-(3-chlorophenyl)-3-(3-pyridin-4-ylpropyl)-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 18002648 |
| Molecular Formula | C22H18ClN3O |
| Molecular Weight | 375.86 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | 1-(3-chlorophenyl)-3-(3-pyridin-4-ylpropyl)-1,8-naphthyridin-2-one |
| SMILES | O=c1c(CCCc2ccncc2)cc2cccnc2n1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C22H18ClN3O/c23-19-7-2-8-20(15-19)26-21-17(6-3-11-25-21)14-18(22(26)27)5-1-4-16-9-12-24-13-10-16/h2-3,6-15H,1,4-5H2 |
| InChIKey | PTUZAZMVPMSRKA-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.86 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |