About 6-(2-aminoacetyl)-3H-1,3-benzothiazol-2-one;hydrochloride
6-(2-aminoacetyl)-3H-1,3-benzothiazol-2-one;hydrochloride (PubChem CID 18002792) has the molecular formula C9H9ClN2O2S
and a molecular weight of 244.70 g/mol. Its IUPAC name is 6-(2-aminoacetyl)-3H-1,3-benzothiazol-2-one;hydrochloride.
Molecular Properties
| Compound Name | 6-(2-aminoacetyl)-3H-1,3-benzothiazol-2-one;hydrochloride |
| PubChem CID | 18002792 |
| Molecular Formula | C9H9ClN2O2S |
| Molecular Weight | 244.70 g/mol |
| Exact Mass | 244.01 |
| IUPAC Name | 6-(2-aminoacetyl)-3H-1,3-benzothiazol-2-one;hydrochloride |
| SMILES | Cl.NCC(=O)c1ccc2[nH]c(=O)sc2c1 |
| InChI | InChI=1S/C9H8N2O2S.ClH/c10-4-7(12)5-1-2-6-8(3-5)14-9(13)11-6;/h1-3H,4,10H2,(H,11,13);1H |
| InChIKey | UHTHQCOOLULWPT-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 75.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.70 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(2-aminoacetyl)-3H-1,3-benzothiazol-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-aminoacetyl)-3H-1,3-benzothiazol-2-one;hydrochloride?
The IUPAC name of 6-(2-aminoacetyl)-3H-1,3-benzothiazol-2-one;hydrochloride (CID 18002792) is 6-(2-aminoacetyl)-3H-1,3-benzothiazol-2-one;hydrochloride.
What is the SMILES notation for 6-(2-aminoacetyl)-3H-1,3-benzothiazol-2-one;hydrochloride?
The canonical SMILES for 6-(2-aminoacetyl)-3H-1,3-benzothiazol-2-one;hydrochloride is Cl.NCC(=O)c1ccc2[nH]c(=O)sc2c1.
What is the InChIKey of 6-(2-aminoacetyl)-3H-1,3-benzothiazol-2-one;hydrochloride?
The InChIKey is UHTHQCOOLULWPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O2S.ClH/c10-4-7(12)5-1-2-6-8(3-5)14-9(13)11-6;/h1-3H,4,10H2,(H,11,13);1H.
What are the key properties of 6-(2-aminoacetyl)-3H-1,3-benzothiazol-2-one;hydrochloride?
6-(2-aminoacetyl)-3H-1,3-benzothiazol-2-one;hydrochloride has a molecular weight of 244.70 g/mol, XLogP of 1.15, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-aminoacetyl)-3H-1,3-benzothiazol-2-one;hydrochloride is sourced from PubChem (CID 18002792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).