About CID 18003134
CID 18003134 (PubChem CID 18003134) has the molecular formula C15H35OSi2
and a molecular weight of 287.62 g/mol.
Molecular Properties
| Compound Name | CID 18003134 |
| PubChem CID | 18003134 |
| Molecular Formula | C15H35OSi2 |
| Molecular Weight | 287.62 g/mol |
| Exact Mass | 287.22 |
| IUPAC Name | — |
| SMILES | CCC[Si](CCC)O[Si](CCC)(CCC)CCC |
| InChI | InChI=1S/C15H35OSi2/c1-6-11-17(12-7-2)16-18(13-8-3,14-9-4)15-10-5/h6-15H2,1-5H3 |
| InChIKey | HQALIEBJFRELDU-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 287.62 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 18003134 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 18003134?
The IUPAC name of CID 18003134 (CID 18003134) is not available.
What is the SMILES notation for CID 18003134?
The canonical SMILES for CID 18003134 is CCC[Si](CCC)O[Si](CCC)(CCC)CCC.
What is the InChIKey of CID 18003134?
The InChIKey is HQALIEBJFRELDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H35OSi2/c1-6-11-17(12-7-2)16-18(13-8-3,14-9-4)15-10-5/h6-15H2,1-5H3.
What are the key properties of CID 18003134?
CID 18003134 has a molecular weight of 287.62 g/mol, XLogP of 5.99, 12 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 18003134 is sourced from PubChem (CID 18003134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).