About 9,9-bis[3-(4-aminophenoxy)phenyl]fluorene-2,7-diamine
9,9-bis[3-(4-aminophenoxy)phenyl]fluorene-2,7-diamine (PubChem CID 18003176) has the molecular formula C37H30N4O2
and a molecular weight of 562.67 g/mol. Its IUPAC name is 9,9-bis[3-(4-aminophenoxy)phenyl]fluorene-2,7-diamine.
Molecular Properties
| Compound Name | 9,9-bis[3-(4-aminophenoxy)phenyl]fluorene-2,7-diamine |
| PubChem CID | 18003176 |
| Molecular Formula | C37H30N4O2 |
| Molecular Weight | 562.67 g/mol |
| Exact Mass | 562.24 |
| IUPAC Name | 9,9-bis[3-(4-aminophenoxy)phenyl]fluorene-2,7-diamine |
| SMILES | Nc1ccc(Oc2cccc(C3(c4cccc(Oc5ccc(N)cc5)c4)c4cc(N)ccc4-c4ccc(N)cc43)c2)cc1 |
| InChI | InChI=1S/C37H30N4O2/c38-25-7-13-29(14-8-25)42-31-5-1-3-23(19-31)37(24-4-2-6-32(20-24)43-30-15-9-26(39)10-16-30)35-21-27(40)11-17-33(35)34-18-12-28(41)22-36(34)37/h1-22H,38-41H2 |
| InChIKey | WGSOHSAXTFWHKO-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 122.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 562.67 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 9,9-bis[3-(4-aminophenoxy)phenyl]fluorene-2,7-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9,9-bis[3-(4-aminophenoxy)phenyl]fluorene-2,7-diamine?
The IUPAC name of 9,9-bis[3-(4-aminophenoxy)phenyl]fluorene-2,7-diamine (CID 18003176) is 9,9-bis[3-(4-aminophenoxy)phenyl]fluorene-2,7-diamine.
What is the SMILES notation for 9,9-bis[3-(4-aminophenoxy)phenyl]fluorene-2,7-diamine?
The canonical SMILES for 9,9-bis[3-(4-aminophenoxy)phenyl]fluorene-2,7-diamine is Nc1ccc(Oc2cccc(C3(c4cccc(Oc5ccc(N)cc5)c4)c4cc(N)ccc4-c4ccc(N)cc43)c2)cc1.
What is the InChIKey of 9,9-bis[3-(4-aminophenoxy)phenyl]fluorene-2,7-diamine?
The InChIKey is WGSOHSAXTFWHKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C37H30N4O2/c38-25-7-13-29(14-8-25)42-31-5-1-3-23(19-31)37(24-4-2-6-32(20-24)43-30-15-9-26(39)10-16-30)35-21-27(40)11-17-33(35)34-18-12-28(41)22-36(34)37/h1-22H,38-41H2.
What are the key properties of 9,9-bis[3-(4-aminophenoxy)phenyl]fluorene-2,7-diamine?
9,9-bis[3-(4-aminophenoxy)phenyl]fluorene-2,7-diamine has a molecular weight of 562.67 g/mol, XLogP of 7.96, 6 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 9,9-bis[3-(4-aminophenoxy)phenyl]fluorene-2,7-diamine is sourced from PubChem (CID 18003176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).