About 2-(aminomethyl)-1,3-thiazole-4-carboxamide
2-(aminomethyl)-1,3-thiazole-4-carboxamide (PubChem CID 18003418) has the molecular formula C5H7N3OS
and a molecular weight of 157.20 g/mol. Its IUPAC name is 2-(aminomethyl)-1,3-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | 2-(aminomethyl)-1,3-thiazole-4-carboxamide |
| PubChem CID | 18003418 |
| Molecular Formula | C5H7N3OS |
| Molecular Weight | 157.20 g/mol |
| Exact Mass | 157.03 |
| IUPAC Name | 2-(aminomethyl)-1,3-thiazole-4-carboxamide |
| SMILES | NCc1nc(C(N)=O)cs1 |
| InChI | InChI=1S/C5H7N3OS/c6-1-4-8-3(2-10-4)5(7)9/h2H,1,6H2,(H2,7,9) |
| InChIKey | VXKQIPWHZSQXLJ-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.20 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(aminomethyl)-1,3-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(aminomethyl)-1,3-thiazole-4-carboxamide?
The IUPAC name of 2-(aminomethyl)-1,3-thiazole-4-carboxamide (CID 18003418) is 2-(aminomethyl)-1,3-thiazole-4-carboxamide.
What is the SMILES notation for 2-(aminomethyl)-1,3-thiazole-4-carboxamide?
The canonical SMILES for 2-(aminomethyl)-1,3-thiazole-4-carboxamide is NCc1nc(C(N)=O)cs1.
What is the InChIKey of 2-(aminomethyl)-1,3-thiazole-4-carboxamide?
The InChIKey is VXKQIPWHZSQXLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N3OS/c6-1-4-8-3(2-10-4)5(7)9/h2H,1,6H2,(H2,7,9).
What are the key properties of 2-(aminomethyl)-1,3-thiazole-4-carboxamide?
2-(aminomethyl)-1,3-thiazole-4-carboxamide has a molecular weight of 157.20 g/mol, XLogP of -0.30, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(aminomethyl)-1,3-thiazole-4-carboxamide is sourced from PubChem (CID 18003418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).