About [2-(2,4-difluorophenyl)-2-(oxan-2-yloxy)ethyl] 4-methylbenzenesulfonate
[2-(2,4-difluorophenyl)-2-(oxan-2-yloxy)ethyl] 4-methylbenzenesulfonate (PubChem CID 18003675) has the molecular formula C20H22F2O5S
and a molecular weight of 412.45 g/mol. Its IUPAC name is [2-(2,4-difluorophenyl)-2-(oxan-2-yloxy)ethyl] 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | [2-(2,4-difluorophenyl)-2-(oxan-2-yloxy)ethyl] 4-methylbenzenesulfonate |
| PubChem CID | 18003675 |
| Molecular Formula | C20H22F2O5S |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | [2-(2,4-difluorophenyl)-2-(oxan-2-yloxy)ethyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC(OC2CCCCO2)c2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C20H22F2O5S/c1-14-5-8-16(9-6-14)28(23,24)26-13-19(27-20-4-2-3-11-25-20)17-10-7-15(21)12-18(17)22/h5-10,12,19-20H,2-4,11,13H2,1H3 |
| InChIKey | USWCMVZYNYISEF-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [2-(2,4-difluorophenyl)-2-(oxan-2-yloxy)ethyl] 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2,4-difluorophenyl)-2-(oxan-2-yloxy)ethyl] 4-methylbenzenesulfonate?
The IUPAC name of [2-(2,4-difluorophenyl)-2-(oxan-2-yloxy)ethyl] 4-methylbenzenesulfonate (CID 18003675) is [2-(2,4-difluorophenyl)-2-(oxan-2-yloxy)ethyl] 4-methylbenzenesulfonate.
What is the SMILES notation for [2-(2,4-difluorophenyl)-2-(oxan-2-yloxy)ethyl] 4-methylbenzenesulfonate?
The canonical SMILES for [2-(2,4-difluorophenyl)-2-(oxan-2-yloxy)ethyl] 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)OCC(OC2CCCCO2)c2ccc(F)cc2F)cc1.
What is the InChIKey of [2-(2,4-difluorophenyl)-2-(oxan-2-yloxy)ethyl] 4-methylbenzenesulfonate?
The InChIKey is USWCMVZYNYISEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22F2O5S/c1-14-5-8-16(9-6-14)28(23,24)26-13-19(27-20-4-2-3-11-25-20)17-10-7-15(21)12-18(17)22/h5-10,12,19-20H,2-4,11,13H2,1H3.
What are the key properties of [2-(2,4-difluorophenyl)-2-(oxan-2-yloxy)ethyl] 4-methylbenzenesulfonate?
[2-(2,4-difluorophenyl)-2-(oxan-2-yloxy)ethyl] 4-methylbenzenesulfonate has a molecular weight of 412.45 g/mol, XLogP of 4.26, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,4-difluorophenyl)-2-(oxan-2-yloxy)ethyl] 4-methylbenzenesulfonate is sourced from PubChem (CID 18003675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).