About (E)-octadec-9-en-1-ol;phosphoric acid
(E)-octadec-9-en-1-ol;phosphoric acid (PubChem CID 18003832) has the molecular formula C18H39O5P
and a molecular weight of 366.48 g/mol. Its IUPAC name is (E)-octadec-9-en-1-ol;phosphoric acid.
Molecular Properties
| Compound Name | (E)-octadec-9-en-1-ol;phosphoric acid |
| PubChem CID | 18003832 |
| Molecular Formula | C18H39O5P |
| Molecular Weight | 366.48 g/mol |
| Exact Mass | 366.25 |
| IUPAC Name | (E)-octadec-9-en-1-ol;phosphoric acid |
| SMILES | CCCCCCCC/C=C/CCCCCCCCO.O=P(O)(O)O |
| InChI | InChI=1S/C18H36O.H3O4P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19;1-5(2,3)4/h9-10,19H,2-8,11-18H2,1H3;(H3,1,2,3,4)/b10-9+; |
| InChIKey | JGVOASSDYQIBIF-RRABGKBLSA-N |
| XLogP | 5.09 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.48 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (E)-octadec-9-en-1-ol;phosphoric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-octadec-9-en-1-ol;phosphoric acid?
The IUPAC name of (E)-octadec-9-en-1-ol;phosphoric acid (CID 18003832) is (E)-octadec-9-en-1-ol;phosphoric acid.
What is the SMILES notation for (E)-octadec-9-en-1-ol;phosphoric acid?
The canonical SMILES for (E)-octadec-9-en-1-ol;phosphoric acid is CCCCCCCC/C=C/CCCCCCCCO.O=P(O)(O)O.
What is the InChIKey of (E)-octadec-9-en-1-ol;phosphoric acid?
The InChIKey is JGVOASSDYQIBIF-RRABGKBLSA-N. The full InChI is InChI=1S/C18H36O.H3O4P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19;1-5(2,3)4/h9-10,19H,2-8,11-18H2,1H3;(H3,1,2,3,4)/b10-9+;.
What are the key properties of (E)-octadec-9-en-1-ol;phosphoric acid?
(E)-octadec-9-en-1-ol;phosphoric acid has a molecular weight of 366.48 g/mol, XLogP of 5.09, 15 rotatable bonds, 4 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-octadec-9-en-1-ol;phosphoric acid is sourced from PubChem (CID 18003832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).