About 4-[2,6-bis(4-butoxyphenyl)-4-pyridinyl]-N,N-dimethylaniline
4-[2,6-bis(4-butoxyphenyl)-4-pyridinyl]-N,N-dimethylaniline (PubChem CID 18004091) has the molecular formula C33H38N2O2
and a molecular weight of 494.68 g/mol. Its IUPAC name is 4-[2,6-bis(4-butoxyphenyl)-4-pyridinyl]-N,N-dimethylaniline.
Molecular Properties
| Compound Name | 4-[2,6-bis(4-butoxyphenyl)-4-pyridinyl]-N,N-dimethylaniline |
| PubChem CID | 18004091 |
| Molecular Formula | C33H38N2O2 |
| Molecular Weight | 494.68 g/mol |
| Exact Mass | 494.29 |
| IUPAC Name | 4-[2,6-bis(4-butoxyphenyl)-4-pyridinyl]-N,N-dimethylaniline |
| SMILES | CCCCOc1ccc(-c2cc(-c3ccc(N(C)C)cc3)cc(-c3ccc(OCCCC)cc3)n2)cc1 |
| InChI | InChI=1S/C33H38N2O2/c1-5-7-21-36-30-17-11-26(12-18-30)32-23-28(25-9-15-29(16-10-25)35(3)4)24-33(34-32)27-13-19-31(20-14-27)37-22-8-6-2/h9-20,23-24H,5-8,21-22H2,1-4H3 |
| InChIKey | IMMITVHCYCDUPK-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 494.68 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[2,6-bis(4-butoxyphenyl)-4-pyridinyl]-N,N-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2,6-bis(4-butoxyphenyl)-4-pyridinyl]-N,N-dimethylaniline?
The IUPAC name of 4-[2,6-bis(4-butoxyphenyl)-4-pyridinyl]-N,N-dimethylaniline (CID 18004091) is 4-[2,6-bis(4-butoxyphenyl)-4-pyridinyl]-N,N-dimethylaniline.
What is the SMILES notation for 4-[2,6-bis(4-butoxyphenyl)-4-pyridinyl]-N,N-dimethylaniline?
The canonical SMILES for 4-[2,6-bis(4-butoxyphenyl)-4-pyridinyl]-N,N-dimethylaniline is CCCCOc1ccc(-c2cc(-c3ccc(N(C)C)cc3)cc(-c3ccc(OCCCC)cc3)n2)cc1.
What is the InChIKey of 4-[2,6-bis(4-butoxyphenyl)-4-pyridinyl]-N,N-dimethylaniline?
The InChIKey is IMMITVHCYCDUPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H38N2O2/c1-5-7-21-36-30-17-11-26(12-18-30)32-23-28(25-9-15-29(16-10-25)35(3)4)24-33(34-32)27-13-19-31(20-14-27)37-22-8-6-2/h9-20,23-24H,5-8,21-22H2,1-4H3.
What are the key properties of 4-[2,6-bis(4-butoxyphenyl)-4-pyridinyl]-N,N-dimethylaniline?
4-[2,6-bis(4-butoxyphenyl)-4-pyridinyl]-N,N-dimethylaniline has a molecular weight of 494.68 g/mol, XLogP of 8.51, 12 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2,6-bis(4-butoxyphenyl)-4-pyridinyl]-N,N-dimethylaniline is sourced from PubChem (CID 18004091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).